EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19BrO |
| Net Charge | 0 |
| Average Mass | 295.220 |
| Monoisotopic Mass | 294.06193 |
| SMILES | [H][C@]12CC[C@@](C)(c3cc(Br)c(C)cc3O)[C@@]1(C)C2 |
| InChI | InChI=1S/C15H19BrO/c1-9-6-13(17)11(7-12(9)16)14(2)5-4-10-8-15(10,14)3/h6-7,10,17H,4-5,8H2,1-3H3/t10-,14+,15+/m1/s1 |
| InChIKey | UGGAHNIITODSKB-ONERCXAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aplysia kurodai (ncbitaxon:6501) | - | PubMed (11302194) | |
| Palisada intermedia (ncbitaxon:397057) | - | DOI (10.1016/S0040-4020(01)92906-0) | Species also known as Laurencia intermedia. |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laurinterol (CHEBI:66555) has role antibacterial agent (CHEBI:33282) |
| laurinterol (CHEBI:66555) has role apoptosis inducer (CHEBI:68495) |
| laurinterol (CHEBI:66555) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| laurinterol (CHEBI:66555) has role metabolite (CHEBI:25212) |
| laurinterol (CHEBI:66555) is a organobromine compound (CHEBI:37141) |
| laurinterol (CHEBI:66555) is a phenols (CHEBI:33853) |
| laurinterol (CHEBI:66555) is a sesquiterpenoid (CHEBI:26658) |
| Incoming Relation(s) |
| debromolaurinterol (CHEBI:66556) has functional parent laurinterol (CHEBI:66555) |
| Manual Xrefs | Databases |
|---|---|
| C17136 | KEGG COMPOUND |
| JP8245359 | Patent |
| WO2009048195 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1880118 | Reaxys |
| CAS:10539-87-4 | ChemIDplus |
| CAS:10539-87-4 | KEGG COMPOUND |
| Citations |
|---|