EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66555 - laurinterol
| Formula | C15H19BrO |
| Net Charge | 0 |
| Average Mass | 295.220 |
| Monoisotopic Mass | 294.06193 |
| SMILES | [H][C@]12CC[C@@](C)(c3cc(Br)c(C)cc3O)[C@@]1(C)C2 |
| InChI | InChI=1S/C15H19BrO/c1-9-6-13(17)11(7-12(9)16)14(2)5-4-10-8-15(10,14)3/h6-7,10,17H,4-5,8H2,1-3H3/t10-,14+,15+/m1/s1 |
| InChIKey | UGGAHNIITODSKB-ONERCXAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Palisada intermedia (ncbitaxon:397057) | - | DOI (10.1016/S0040-4020(01)92906-0) | Species also known as Laurencia intermedia. |
| Aplysia kurodai (ncbitaxon:6501) | - | PubMed (11302194) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laurinterol (CHEBI:66555) has role antibacterial agent (CHEBI:33282) |
| laurinterol (CHEBI:66555) has role apoptosis inducer (CHEBI:68495) |
| laurinterol (CHEBI:66555) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| laurinterol (CHEBI:66555) has role metabolite (CHEBI:25212) |
| laurinterol (CHEBI:66555) is a organobromine compound (CHEBI:37141) |
| laurinterol (CHEBI:66555) is a phenols (CHEBI:33853) |
| laurinterol (CHEBI:66555) is a sesquiterpenoid (CHEBI:26658) |
| Incoming Relation(s) |
| debromolaurinterol (CHEBI:66556) has functional parent laurinterol (CHEBI:66555) |
| Manual Xrefs | Databases |
|---|---|
| C17136 | KEGG COMPOUND |
| WO2009048195 | Patent |
| JP8245359 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1880118 | Reaxys |
| CAS:10539-87-4 | KEGG COMPOUND |
| CAS:10539-87-4 | ChemIDplus |
| Citations |
|---|