EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H64O13 |
| Net Charge | 0 |
| Average Mass | 740.928 |
| Monoisotopic Mass | 740.43469 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@]2([H])O[C@H]2CC[C@@]3(C)[C@]([H])(CC[C@]4([H])[C@]3([H])CC[C@@]3(C)[C@@]4([H])C[C@]4([H])O[C@]5(CC[C@@H](C)CO5)[C@@H](C)[C@]34[H])C2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C39H64O13/c1-18-7-12-39(47-17-18)19(2)28-25(52-39)14-24-22-6-5-20-13-21(8-10-37(20,3)23(22)9-11-38(24,28)4)48-36-34(32(45)30(43)27(16-41)50-36)51-35-33(46)31(44)29(42)26(15-40)49-35/h18-36,40-46H,5-17H2,1-4H3/t18-,19+,20-,21+,22-,23+,24+,25+,26-,27-,28+,29-,30+,31+,32+,33-,34-,35+,36-,37+,38+,39-/m1/s1 |
| InChIKey | MMTWXUQMLQGAPC-KQRWKONWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Yucca gloriosa (ncbitaxon:1087055) | stem (BTO:0001300) | DOI (10.1016/0031-9422(89)80212-2) | Fresh caudex |
| Yucca guatemalensis (ncbitaxon:480092) | stem (BTO:0001300) | PubMed (17675194) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ys-II (CHEBI:66497) has functional parent (25R)-5β-spirostan-3β-ol (CHEBI:28933) |
| Ys-II (CHEBI:66497) has role antifungal agent (CHEBI:35718) |
| Ys-II (CHEBI:66497) has role metabolite (CHEBI:25212) |
| Ys-II (CHEBI:66497) is a disaccharide derivative (CHEBI:63353) |
| Ys-II (CHEBI:66497) is a organic heterohexacyclic compound (CHEBI:51914) |
| Ys-II (CHEBI:66497) is a oxaspiro compound (CHEBI:37948) |
| Ys-II (CHEBI:66497) is a spirostanyl glycoside (CHEBI:38091) |
| IUPAC Name |
|---|
| (3β,5β,25R)-spirostan-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| Synonym | Source |
|---|---|
| smilagenin 3-O-β-D-glucopyranosyl-(1→2)-β-D-galactopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8804178 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7004187 | Reaxys |
| Citations |
|---|