EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H64O13 |
| Net Charge | 0 |
| Average Mass | 740.928 |
| Monoisotopic Mass | 740.43469 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@]2([H])O[C@H]2CC[C@@]3(C)[C@]([H])(CC[C@]4([H])[C@]3([H])CC[C@@]3(C)[C@@]4([H])C[C@]4([H])O[C@]5(CC[C@@H](C)CO5)[C@@H](C)[C@]34[H])C2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C39H64O13/c1-18-7-12-39(47-17-18)19(2)28-25(52-39)14-24-22-6-5-20-13-21(8-10-37(20,3)23(22)9-11-38(24,28)4)48-36-34(32(45)30(43)27(16-41)50-36)51-35-33(46)31(44)29(42)26(15-40)49-35/h18-36,40-46H,5-17H2,1-4H3/t18-,19+,20-,21+,22-,23+,24+,25+,26-,27-,28+,29-,30+,31+,32+,33-,34-,35+,36-,37+,38+,39-/m1/s1 |
| InChIKey | MMTWXUQMLQGAPC-KQRWKONWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Yucca guatemalensis (ncbitaxon:480092) | stem (BTO:0001300) | PubMed (17675194) | |
| Yucca gloriosa (ncbitaxon:1087055) | stem (BTO:0001300) | DOI (10.1016/0031-9422(89)80212-2) | Fresh caudex |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ys-II (CHEBI:66497) has functional parent (25R)-5β-spirostan-3β-ol (CHEBI:28933) |
| Ys-II (CHEBI:66497) has role antifungal agent (CHEBI:35718) |
| Ys-II (CHEBI:66497) has role metabolite (CHEBI:25212) |
| Ys-II (CHEBI:66497) is a disaccharide derivative (CHEBI:63353) |
| Ys-II (CHEBI:66497) is a organic heterohexacyclic compound (CHEBI:51914) |
| Ys-II (CHEBI:66497) is a oxaspiro compound (CHEBI:37948) |
| Ys-II (CHEBI:66497) is a spirostanyl glycoside (CHEBI:38091) |
| IUPAC Name |
|---|
| (3β,5β,25R)-spirostan-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| Synonym | Source |
|---|---|
| smilagenin 3-O-β-D-glucopyranosyl-(1→2)-β-D-galactopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8804178 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7004187 | Reaxys |
| Citations |
|---|