EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])C[C@]3([H])O[C@]5(CC[C@@H](C)CO5)[C@@H](C)[C@]43[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C27H44O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-24,28H,5-15H2,1-4H3/t16-,17+,18-,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | GMBQZIIUCVWOCD-UQHLGXRBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-5β-spirostan-3β-ol (CHEBI:28933) has parent hydride (25R)-5β-spirostan (CHEBI:35535) |
| (25R)-5β-spirostan-3β-ol (CHEBI:28933) has role antineoplastic agent (CHEBI:35610) |
| (25R)-5β-spirostan-3β-ol (CHEBI:28933) has role metabolite (CHEBI:25212) |
| (25R)-5β-spirostan-3β-ol (CHEBI:28933) is a 3β-hydroxy steroid (CHEBI:36836) |
| (25R)-5β-spirostan-3β-ol (CHEBI:28933) is a organic heterohexacyclic compound (CHEBI:51914) |
| (25R)-5β-spirostan-3β-ol (CHEBI:28933) is a oxaspiro compound (CHEBI:37948) |
| (25R)-5β-spirostan-3β-ol (CHEBI:28933) is a sapogenin (CHEBI:26606) |
| Incoming Relation(s) |
| Ys-II (CHEBI:66497) has functional parent (25R)-5β-spirostan-3β-ol (CHEBI:28933) |
| Ys-IV (CHEBI:66498) has functional parent (25R)-5β-spirostan-3β-ol (CHEBI:28933) |
| IUPAC Name |
|---|
| (3β,5β,25R)-spirostan-3-ol |
| Synonyms | Source |
|---|---|
| (25R)-5beta-spirostan-3beta-ol | ChEBI |
| (25R)-5beta-Spirostan-3beta-ol | KEGG COMPOUND |
| Isosarsapogenin | HMDB |
| Smilagenin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003592 | KNApSAcK |
| C08913 | KEGG COMPOUND |
| HMDB0030048 | HMDB |
| KR20090007505 | Patent |
| KR20090009997 | Patent |
| LMST01080005 | LIPID MAPS |
| UA81133 | Patent |
| US2007191290 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:91753 | Reaxys |
| CAS:126-18-1 | KEGG COMPOUND |
| CAS:126-18-1 | ChemIDplus |
| Citations |
|---|