EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H30O13 |
| Net Charge | 0 |
| Average Mass | 598.557 |
| Monoisotopic Mass | 598.16864 |
| SMILES | Cc1c(O)c2c(c(C)c1O[C@@H]1O[C@H](COC(=O)c3ccc(O)cc3)[C@@H](O)[C@H](O)[C@H]1O)O[C@H](c1cc(O)ccc1O)CC2=O |
| InChI | InChI=1S/C30H30O13/c1-12-23(35)22-19(34)10-20(17-9-16(32)7-8-18(17)33)41-28(22)13(2)27(12)43-30-26(38)25(37)24(36)21(42-30)11-40-29(39)14-3-5-15(31)6-4-14/h3-9,20-21,24-26,30-33,35-38H,10-11H2,1-2H3/t20-,21+,24+,25-,26+,30-/m0/s1 |
| InChIKey | UNSZUCUHDNOPMN-FJPKCJJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrcia multiflora (ncbitaxon:375255) | leaf (BTO:0000713) | PubMed (11911215) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myrciacitrin V (CHEBI:66421) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| myrciacitrin V (CHEBI:66421) has role plant metabolite (CHEBI:76924) |
| myrciacitrin V (CHEBI:66421) is a 4-hydroxybenzoate ester (CHEBI:79323) |
| myrciacitrin V (CHEBI:66421) is a flavanone glycoside (CHEBI:72730) |
| myrciacitrin V (CHEBI:66421) is a monosaccharide derivative (CHEBI:63367) |
| myrciacitrin V (CHEBI:66421) is a trihydroxyflavanone (CHEBI:38739) |
| myrciacitrin V (CHEBI:66421) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2S)-2-(2,5-dihydroxyphenyl)-5-hydroxy-6,8-dimethyl-4-oxo-3,4-dihydro-2H-chromen-7-yl 6-O-(4-hydroxybenzoyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (2S)-6,8-dimethyl-5,7,2',5'-tetrahydroxyflavanone7-O-(6''-O-p-hydroxybenzoyl)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9178375 | Reaxys |
| Citations |
|---|