EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32O13 |
| Net Charge | 0 |
| Average Mass | 624.595 |
| Monoisotopic Mass | 624.18429 |
| SMILES | Cc1c(O)c2c(c(C)c1O[C@@H]1O[C@H](COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)[C@H](O)[C@H]1O)O[C@H](c1cc(O)ccc1O)CC2=O |
| InChI | InChI=1S/C32H32O13/c1-14-26(38)25-21(36)12-22(19-11-18(34)8-9-20(19)35)43-31(25)15(2)30(14)45-32-29(41)28(40)27(39)23(44-32)13-42-24(37)10-5-16-3-6-17(33)7-4-16/h3-11,22-23,27-29,32-35,38-41H,12-13H2,1-2H3/b10-5+/t22-,23+,27+,28-,29+,32-/m0/s1 |
| InChIKey | VPHZQTMMIZNNMH-DHVWHUDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrcia multiflora (ncbitaxon:375255) | leaf (BTO:0000713) | PubMed (11911215) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myrciacitrin IV (CHEBI:66420) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| myrciacitrin IV (CHEBI:66420) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| myrciacitrin IV (CHEBI:66420) has role metabolite (CHEBI:25212) |
| myrciacitrin IV (CHEBI:66420) is a cinnamate ester (CHEBI:36087) |
| myrciacitrin IV (CHEBI:66420) is a flavanone glycoside (CHEBI:72730) |
| myrciacitrin IV (CHEBI:66420) is a monosaccharide derivative (CHEBI:63367) |
| myrciacitrin IV (CHEBI:66420) is a trihydroxyflavanone (CHEBI:38739) |
| myrciacitrin IV (CHEBI:66420) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2S)-2-(2,5-dihydroxyphenyl)-5-hydroxy-6,8-dimethyl-4-oxo-3,4-dihydro-2H-chromen-7-yl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (2S)-6,8-dimethyl-5,7,2',5'-tetrahydroxyflavanone7-O-(6''-O-p-coumaroyl)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9178916 | Reaxys |
| Citations |
|---|