EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32O13 |
| Net Charge | 0 |
| Average Mass | 624.595 |
| Monoisotopic Mass | 624.18429 |
| SMILES | Cc1c(O)c2c(c(C)c1O[C@@H]1O[C@H](COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)[C@H](O)[C@H]1O)O[C@H](c1cc(O)ccc1O)CC2=O |
| InChI | InChI=1S/C32H32O13/c1-14-26(38)25-21(36)12-22(19-11-18(34)8-9-20(19)35)43-31(25)15(2)30(14)45-32-29(41)28(40)27(39)23(44-32)13-42-24(37)10-5-16-3-6-17(33)7-4-16/h3-11,22-23,27-29,32-35,38-41H,12-13H2,1-2H3/b10-5+/t22-,23+,27+,28-,29+,32-/m0/s1 |
| InChIKey | VPHZQTMMIZNNMH-DHVWHUDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrcia multiflora (ncbitaxon:375255) | leaf (BTO:0000713) | PubMed (11911215) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myrciacitrin IV (CHEBI:66420) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| myrciacitrin IV (CHEBI:66420) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| myrciacitrin IV (CHEBI:66420) has role metabolite (CHEBI:25212) |
| myrciacitrin IV (CHEBI:66420) is a cinnamate ester (CHEBI:36087) |
| myrciacitrin IV (CHEBI:66420) is a flavanone glycoside (CHEBI:72730) |
| myrciacitrin IV (CHEBI:66420) is a monosaccharide derivative (CHEBI:63367) |
| myrciacitrin IV (CHEBI:66420) is a trihydroxyflavanone (CHEBI:38739) |
| myrciacitrin IV (CHEBI:66420) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2S)-2-(2,5-dihydroxyphenyl)-5-hydroxy-6,8-dimethyl-4-oxo-3,4-dihydro-2H-chromen-7-yl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (2S)-6,8-dimethyl-5,7,2',5'-tetrahydroxyflavanone7-O-(6''-O-p-coumaroyl)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9178916 | Reaxys |
| Citations |
|---|