EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O6 |
| Net Charge | 0 |
| Average Mass | 424.578 |
| Monoisotopic Mass | 424.28249 |
| SMILES | [H][C@@]1([C@@H](C)C(=O)O)CC[C@](C)(CC/C=C(\C)CCC(=O)C(C)(C)CCCC(C)=O)OO1 |
| InChI | InChI=1S/C24H40O6/c1-17(11-12-21(26)23(4,5)14-8-10-18(2)25)9-7-15-24(6)16-13-20(29-30-24)19(3)22(27)28/h9,19-20H,7-8,10-16H2,1-6H3,(H,27,28)/b17-9+/t19-,20+,24+/m1/s1 |
| InChIKey | UCWHHFGTUDDROG-DNKDVBPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diacarnus erythraeanus (WORMS:168712) | - | PubMed (11325240) |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muqubilone (CHEBI:66415) has role anti-HSV-1 agent (CHEBI:64953) |
| muqubilone (CHEBI:66415) has role metabolite (CHEBI:25212) |
| muqubilone (CHEBI:66415) is a dioxo monocarboxylic acid (CHEBI:35951) |
| muqubilone (CHEBI:66415) is a methyl ketone (CHEBI:51867) |
| muqubilone (CHEBI:66415) is a organic peroxide (CHEBI:25702) |
| muqubilone (CHEBI:66415) is a sesterterpenoid (CHEBI:26660) |
| muqubilone (CHEBI:66415) is a terpene ketone (CHEBI:26872) |
| Citations |
|---|