EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23Br2NO2 |
| Net Charge | 0 |
| Average Mass | 421.173 |
| Monoisotopic Mass | 419.00955 |
| SMILES | O=C(O)[C@@H]1N=C1/C=C/CCCCCCCCCC=C(Br)Br |
| InChI | InChI=1S/C16H23Br2NO2/c17-14(18)12-10-8-6-4-2-1-3-5-7-9-11-13-15(19-13)16(20)21/h9,11-12,15H,1-8,10H2,(H,20,21)/b11-9+/t15-/m1/s1 |
| InChIKey | XWKHPPWOUIGVPT-SLZMIMFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Siliquariaspongia (WORMS:171246) | - | PubMed (19191563) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motualevic acid F (CHEBI:66406) has functional parent 2H-azirine (CHEBI:30971) |
| motualevic acid F (CHEBI:66406) has role antibacterial agent (CHEBI:33282) |
| motualevic acid F (CHEBI:66406) has role metabolite (CHEBI:25212) |
| motualevic acid F (CHEBI:66406) is a monocarboxylic acid (CHEBI:25384) |
| motualevic acid F (CHEBI:66406) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (2R)-3-[(1E)-13,13-dibromotrideca-1,12-dien-1-yl]-2H-azirene-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19364082 | Reaxys |
| Citations |
|---|