EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23Br2NO2 |
| Net Charge | 0 |
| Average Mass | 421.173 |
| Monoisotopic Mass | 419.00955 |
| SMILES | O=C(O)[C@@H]1N=C1/C=C/CCCCCCCCCC=C(Br)Br |
| InChI | InChI=1S/C16H23Br2NO2/c17-14(18)12-10-8-6-4-2-1-3-5-7-9-11-13-15(19-13)16(20)21/h9,11-12,15H,1-8,10H2,(H,20,21)/b11-9+/t15-/m1/s1 |
| InChIKey | XWKHPPWOUIGVPT-SLZMIMFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Siliquariaspongia (WORMS:171246) | - | PubMed (19191563) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motualevic acid F (CHEBI:66406) has functional parent 2H-azirine (CHEBI:30971) |
| motualevic acid F (CHEBI:66406) has role antibacterial agent (CHEBI:33282) |
| motualevic acid F (CHEBI:66406) has role metabolite (CHEBI:25212) |
| motualevic acid F (CHEBI:66406) is a monocarboxylic acid (CHEBI:25384) |
| motualevic acid F (CHEBI:66406) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (2R)-3-[(1E)-13,13-dibromotrideca-1,12-dien-1-yl]-2H-azirene-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19364082 | Reaxys |
| Citations |
|---|