EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36O9 |
| Net Charge | 0 |
| Average Mass | 576.642 |
| Monoisotopic Mass | 576.23593 |
| SMILES | [H][C@]12OC(C)(C)[C@]3(C/C=C(/C)C(=O)O)C[C@]([H])(C1=O)C1OC14C(=O)c1c(O)c5c(c(CC=C(C)C)c1O[C@]432)OC(C)(C)C=C5 |
| InChI | InChI=1S/C33H36O9/c1-15(2)8-9-18-23-17(11-12-29(4,5)39-23)21(34)20-24(18)40-33-27-22(35)19(26-32(33,42-26)25(20)36)14-31(33,30(6,7)41-27)13-10-16(3)28(37)38/h8,10-12,19,26-27,34H,9,13-14H2,1-7H3,(H,37,38)/b16-10-/t19-,26?,27+,31+,32?,33+/m1/s1 |
| InChIKey | DHCUJGJZVIRMQU-ZZBIGSJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia hanburyi (ncbitaxon:231906) | |||
| latex (BTO:0000710) | PubMed (17117343) | Previous component: resin; | |
| fruit (BTO:0000486) | PubMed (17117343) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has functional parent morellic acid (CHEBI:66401) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has role anti-HIV-1 agent (CHEBI:64947) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has role antineoplastic agent (CHEBI:35610) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has role metabolite (CHEBI:25212) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a cyclic ketone (CHEBI:3992) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a epoxide (CHEBI:32955) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a organic heterohexacyclic compound (CHEBI:51914) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a phenols (CHEBI:33853) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a polycyclic cage (CHEBI:33640) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2Z)-4-[(2S,3aR,6S,6aR)-13-hydroxy-5,5,10,10-tetramethyl-8-(3-methylbut-2-en-1-yl)-3,14-dioxo-1a,2,3,3a-tetrahydro-10H,14H-2,6-methanofuro[3,2-g]oxireno[k]pyrano[3,2-b]xanthen-6(5H)-yl]-2-methylbut-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11109913 | Reaxys |
| Citations |
|---|