EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36O9 |
| Net Charge | 0 |
| Average Mass | 576.642 |
| Monoisotopic Mass | 576.23593 |
| SMILES | [H][C@]12OC(C)(C)[C@]3(C/C=C(/C)C(=O)O)C[C@]([H])(C1=O)C1OC14C(=O)c1c(O)c5c(c(CC=C(C)C)c1O[C@]432)OC(C)(C)C=C5 |
| InChI | InChI=1S/C33H36O9/c1-15(2)8-9-18-23-17(11-12-29(4,5)39-23)21(34)20-24(18)40-33-27-22(35)19(26-32(33,42-26)25(20)36)14-31(33,30(6,7)41-27)13-10-16(3)28(37)38/h8,10-12,19,26-27,34H,9,13-14H2,1-7H3,(H,37,38)/b16-10-/t19-,26?,27+,31+,32?,33+/m1/s1 |
| InChIKey | DHCUJGJZVIRMQU-ZZBIGSJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia hanburyi (ncbitaxon:231906) | |||
| fruit (BTO:0000486) | PubMed (17117343) | ||
| latex (BTO:0000710) | PubMed (17117343) | Previous component: resin; |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has functional parent morellic acid (CHEBI:66401) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has role anti-HIV-1 agent (CHEBI:64947) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has role antineoplastic agent (CHEBI:35610) |
| 8,8a-epoxymorellic acid (CHEBI:66402) has role metabolite (CHEBI:25212) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a cyclic ketone (CHEBI:3992) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a epoxide (CHEBI:32955) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a organic heterohexacyclic compound (CHEBI:51914) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a phenols (CHEBI:33853) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a polycyclic cage (CHEBI:33640) |
| 8,8a-epoxymorellic acid (CHEBI:66402) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2Z)-4-[(2S,3aR,6S,6aR)-13-hydroxy-5,5,10,10-tetramethyl-8-(3-methylbut-2-en-1-yl)-3,14-dioxo-1a,2,3,3a-tetrahydro-10H,14H-2,6-methanofuro[3,2-g]oxireno[k]pyrano[3,2-b]xanthen-6(5H)-yl]-2-methylbut-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11109913 | Reaxys |
| Citations |
|---|