EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O13 |
| Net Charge | 0 |
| Average Mass | 478.362 |
| Monoisotopic Mass | 478.07474 |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O13/c22-7-4-10(25)12-11(5-7)32-17(6-1-2-8(23)9(24)3-6)18(13(12)26)33-21-16(29)14(27)15(28)19(34-21)20(30)31/h1-5,14-16,19,21-25,27-29H,(H,30,31)/t14-,15-,16+,19-,21+/m0/s1 |
| InChIKey | DUBCCGAQYVUYEU-ZUGPOPFOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum perforatum (ncbitaxon:65561) | - | PubMed (14735439) | |
| Foeniculum dulce (IPNI:842661-1) | flower (BTO:0000469) | DOI (10.3390/70200245) | |
| Schinus molle (ncbitaxon:43851) | leaf (BTO:0000713) | PubMed (16521111) | |
| Foeniculum vulgare (ncbitaxon:48038) | flower (BTO:0000469) | DOI (10.3390/70200245) | |
| Callistemon lanceolatus (ncbitaxon:155884) | |||
| flower (BTO:0000469) | PubMed (18618463) | ||
| leaf (BTO:0000713) | PubMed (18618463) | ||
| Hypericum hirsutum (ncbitaxon:673928) | - | DOI (10.1007/BF00597593) | |
| Polygonum salicifolium (IPNI:696398-1) | aerial part (BTO:0001658) | PubMed (10479312) | |
| Phaseolus vulgaris (ncbitaxon:3885) | - | DOI (10.1021/jf980687v) | |
| Reynoutria sachalinensis (ncbitaxon:76036) | flower (BTO:0000469) | PubMed (15742803) | |
| Salvia (ncbitaxon:21880) | - | PubMed (11809447) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| miquelianin (CHEBI:66395) has role antidepressant (CHEBI:35469) |
| miquelianin (CHEBI:66395) has role antioxidant (CHEBI:22586) |
| miquelianin (CHEBI:66395) has role metabolite (CHEBI:25212) |
| miquelianin (CHEBI:66395) is a quercetin O-glycoside (CHEBI:76424) |
| miquelianin (CHEBI:66395) is a β-D-glucosiduronic acid (CHEBI:15341) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| quercetin-3-O-β-D-glucuronopyranoside | ChEBI |
| quercituron | ChemIDplus |
| quercetin 3-O-glucuronide | HMDB |
| quercetin-3-O-glucoronoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12112173 | LIPID MAPS |
| Miquelianin | Wikipedia |
| HMDB0029212 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:72004 | Reaxys |
| CAS:22688-79-5 | ChemIDplus |
| Citations |
|---|