EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O7 |
| Net Charge | 0 |
| Average Mass | 486.605 |
| Monoisotopic Mass | 486.26175 |
| SMILES | [H][C@@]12C[C@H]3O[C@]34[C@@H](O)C=CC(=O)[C@]4(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(O)[C@@](C)(O)[C@@]1([H])CC(C)=C(C)C(=O)O1 |
| InChI | InChI=1S/C28H38O7/c1-14-12-21(34-23(31)15(14)2)26(5,32)27(33)11-9-17-16-13-22-28(35-22)20(30)7-6-19(29)25(28,4)18(16)8-10-24(17,27)3/h6-7,16-18,20-22,30,32-33H,8-13H2,1-5H3/t16-,17-,18-,20-,21+,22+,24-,25-,26-,27+,28+/m0/s1 |
| InChIKey | JVEUOKCSZLCPOI-IBELMYMKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tubocapsicum anomalum (ncbitaxon:180580) | - | PubMed (17417907) | |
| Withania somnifera (ncbitaxon:126910) | leaf (BTO:0000713) | DOI (10.1016/0031-9422(75)85035-7) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17α-hydroxywithanolide D (CHEBI:66329) has functional parent withanolide D (CHEBI:10041) |
| 17α-hydroxywithanolide D (CHEBI:66329) has role antineoplastic agent (CHEBI:35610) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a 17α-hydroxy steroid (CHEBI:35342) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a 20-hydroxy steroid (CHEBI:36854) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a 4-hydroxy steroid (CHEBI:62846) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a enone (CHEBI:51689) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a epoxy steroid (CHEBI:145217) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a ergostanoid (CHEBI:50403) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a secondary alcohol (CHEBI:35681) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a tertiary alcohol (CHEBI:26878) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a withanolide (CHEBI:74716) |
| 17α-hydroxywithanolide D (CHEBI:66329) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4β,5β,6β,22R)-4,17,20-trihydroxy-5,6:22,26-diepoxyergosta-2,24-diene-1,26-dione |
| Synonym | Source |
|---|---|
| 4β,17α,20α-trihydroxy-1-oxo-5β,6β-epoxy-20S,22R-witha-2,24-dienolide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11130253 | Reaxys |
| Citations |
|---|