EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O6 |
| Net Charge | 0 |
| Average Mass | 470.606 |
| Monoisotopic Mass | 470.26684 |
| SMILES | [H][C@@]12C[C@H]3O[C@]34[C@@H](O)C=CC(=O)[C@]4(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@@](C)(O)[C@@]1([H])CC(C)=C(C)C(=O)O1 |
| InChI | InChI=1S/C28H38O6/c1-14-12-22(33-24(31)15(14)2)27(5,32)19-7-6-17-16-13-23-28(34-23)21(30)9-8-20(29)26(28,4)18(16)10-11-25(17,19)3/h8-9,16-19,21-23,30,32H,6-7,10-13H2,1-5H3/t16-,17-,18-,19-,21-,22+,23+,25-,26-,27+,28+/m0/s1 |
| InChIKey | SASUFNRGCZMRFD-JCUIILOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tubocapsicum anomalum (ncbitaxon:180580) | - | PubMed (17417907) | |
| Withania somnifera (ncbitaxon:126910) | leaf (BTO:0000713) | DOI (10.1016/0031-9422(75)85035-7) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| withanolide D (CHEBI:10041) has role antibacterial agent (CHEBI:33282) |
| withanolide D (CHEBI:10041) has role antineoplastic agent (CHEBI:35610) |
| withanolide D (CHEBI:10041) is a 20-hydroxy steroid (CHEBI:36854) |
| withanolide D (CHEBI:10041) is a 4-hydroxy steroid (CHEBI:62846) |
| withanolide D (CHEBI:10041) is a enone (CHEBI:51689) |
| withanolide D (CHEBI:10041) is a epoxy steroid (CHEBI:145217) |
| withanolide D (CHEBI:10041) is a ergostanoid (CHEBI:50403) |
| withanolide D (CHEBI:10041) is a secondary alcohol (CHEBI:35681) |
| withanolide D (CHEBI:10041) is a tertiary alcohol (CHEBI:26878) |
| withanolide D (CHEBI:10041) is a withanolide (CHEBI:74716) |
| withanolide D (CHEBI:10041) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| 17α-hydroxywithanolide D (CHEBI:66329) has functional parent withanolide D (CHEBI:10041) |
| IUPAC Name |
|---|
| (4β,5β,6β,22R)-4,20-dihydroxy-5,6:22,26-diepoxyergosta-2,24-diene-1,26-dione |
| Synonyms | Source |
|---|---|
| 4β,20α-dihydroxy-1-oxo-5β,6β-epoxy-20S,22R-witha-2,24-dienolide | ChEBI |
| Ajagandha whole | ChEMBL |
| Amukkara in tamil whole | ChEMBL |
| Angelicae sinensis radix | ChEMBL |
| Angelica sinensis | ChEMBL |
| Angelica sinensis (oliv.) diels | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5173298 | Reaxys |
| CAS:30655-48-2 | ChemIDplus |
| CAS:30655-48-2 | KEGG COMPOUND |
| Citations |
|---|