EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O7 |
| Net Charge | 0 |
| Average Mass | 484.589 |
| Monoisotopic Mass | 484.24610 |
| SMILES | [H][C@@]12C[C@H]3O[C@]34[C@@H](O)C=CC(=O)[C@]4(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@@]2([H])O[C@@]12[C@@](C)(O)[C@@]1([H])CC(C)=C(C)C(=O)O1 |
| InChI | InChI=1S/C28H36O7/c1-13-10-20(33-23(31)14(13)2)26(5,32)28-22(35-28)12-17-15-11-21-27(34-21)19(30)7-6-18(29)25(27,4)16(15)8-9-24(17,28)3/h6-7,15-17,19-22,30,32H,8-12H2,1-5H3/t15-,16+,17+,19+,20-,21-,22-,24+,25+,26+,27-,28-/m1/s1 |
| InChIKey | ONOYEGAYNUISOH-QTRSZHGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tubocapsicum anomalum (ncbitaxon:180580) | - | PubMed (17417907) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) has functional parent tubocapsanolide A (CHEBI:66325) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) has role antineoplastic agent (CHEBI:35610) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a 20-hydroxy steroid (CHEBI:36854) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a 4-hydroxy steroid (CHEBI:62846) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a enone (CHEBI:51689) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a epoxy steroid (CHEBI:145217) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a ergostanoid (CHEBI:50403) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a secondary alcohol (CHEBI:35681) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a tertiary alcohol (CHEBI:26878) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a withanolide (CHEBI:74716) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4β,5β,6β,16α,17α)-17-{(1S)-1-[(2R)-4,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl]-1-hydroxyethyl}-4-hydroxy-5,6:16,17-diepoxyandrost-2-en-1-one |
| Synonym | Source |
|---|---|
| 5β,6β:16α,17α-diepoxy-4β,20-dihydroxy-1-oxo-witha-2,24-dienolide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11130281 | Reaxys |
| Citations |
|---|