EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36O6 |
| Net Charge | 0 |
| Average Mass | 468.590 |
| Monoisotopic Mass | 468.25119 |
| SMILES | [H][C@@]12C[C@@]3([H])O[C@]34[C@@H](O)C=CC(=O)[C@]4(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@@]2([H])O[C@@]12[C@H](C)[C@@]1([H])CC(C)=C(C)C(=O)O1 |
| InChI | InChI=1S/C28H36O6/c1-13-10-19(32-24(31)14(13)2)15(3)27-23(33-27)12-18-16-11-22-28(34-22)21(30)7-6-20(29)26(28,5)17(16)8-9-25(18,27)4/h6-7,15-19,21-23,30H,8-12H2,1-5H3/t15-,16-,17+,18+,19-,21+,22-,23-,25+,26+,27-,28-/m1/s1 |
| InChIKey | RQGXOMVMGPVOQK-KAUDDYPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tubocapsicum anomalum (ncbitaxon:180580) | - | PubMed (17417907) |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tubocapsanolide A (CHEBI:66325) has role antineoplastic agent (CHEBI:35610) |
| tubocapsanolide A (CHEBI:66325) has role NF-κB inhibitor (CHEBI:73240) |
| tubocapsanolide A (CHEBI:66325) is a 4-hydroxy steroid (CHEBI:62846) |
| tubocapsanolide A (CHEBI:66325) is a enone (CHEBI:51689) |
| tubocapsanolide A (CHEBI:66325) is a epoxy steroid (CHEBI:145217) |
| tubocapsanolide A (CHEBI:66325) is a ergostanoid (CHEBI:50403) |
| tubocapsanolide A (CHEBI:66325) is a secondary alcohol (CHEBI:35681) |
| tubocapsanolide A (CHEBI:66325) is a withanolide (CHEBI:74716) |
| tubocapsanolide A (CHEBI:66325) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| 20-hydroxytubocapsanolide A (CHEBI:66326) has functional parent tubocapsanolide A (CHEBI:66325) |
| 23-hydroxytubocapsanolide A (CHEBI:66327) has functional parent tubocapsanolide A (CHEBI:66325) |
| IUPAC Name |
|---|
| (4β,5β,6β,16α,17α)-17-{(1R)-1-[(2R)-4,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl]ethyl}-4-hydroxy-5,6:16,17-diepoxyandrost-2-en-1-one |
| Synonym | Source |
|---|---|
| 5β,6β:16α,17α-diepoxy-4β-hydroxy-1-oxo-witha-2,24-dienolide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11130280 | Reaxys |
| Citations |
|---|