EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66263 - 5,7,4'-trihydroxy-6,8-diprenylisoflavone
| Formula | C25H26O5 |
| Net Charge | 0 |
| Average Mass | 406.478 |
| Monoisotopic Mass | 406.17802 |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| InChI | InChI=1S/C25H26O5/c1-14(2)5-11-18-22(27)19(12-6-15(3)4)25-21(23(18)28)24(29)20(13-30-25)16-7-9-17(26)10-8-16/h5-10,13,26-28H,11-12H2,1-4H3 |
| InChIKey | UCHYSPNEUSDFQR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Derris scandens (IPNI:78024-2) | stem (BTO:0001300) | DOI (10.1016/S0031-9422(99)00103-X) | |
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (16441081) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,7,4'-trihydroxy-6,8-diprenylisoflavone (CHEBI:66263) has functional parent genistein (CHEBI:28088) |
| 5,7,4'-trihydroxy-6,8-diprenylisoflavone (CHEBI:66263) has role antibacterial agent (CHEBI:33282) |
| 5,7,4'-trihydroxy-6,8-diprenylisoflavone (CHEBI:66263) has role plant metabolite (CHEBI:76924) |
| 5,7,4'-trihydroxy-6,8-diprenylisoflavone (CHEBI:66263) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-(4-hydroxyphenyl)-6,8-bis(3-methylbut-2-en-1-yl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 8-prenylwighteone | ChEBI |
| 6,8-diprenylgenistein | ChEBI |
| 8-(γ,γ-dimethylallyl)-wighteone | ChEBI |
| 6,8-diisoprenyl-5,7,4'-trihydroxyisoflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1357039 | Reaxys |
| CAS:51225-28-6 | Reaxys |
| Citations |
|---|