EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H52O25 |
| Net Charge | 0 |
| Average Mass | 932.831 |
| Monoisotopic Mass | 932.27977 |
| SMILES | [H][C@]1(O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](CO)O[C@@H](OC[C@H]2O[C@@H](Oc3cc(OC)cc4c3C(=O)c3c(O)cc(C)cc3C4=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O |
| InChI | InChI=1S/C40H52O25/c1-11-3-13-21(15(43)4-11)28(49)22-14(23(13)44)5-12(57-2)6-16(22)60-39-33(54)30(51)25(46)19(63-39)10-59-38-35(56)36(27(48)18(8-42)62-38)65-40-34(55)31(52)26(47)20(64-40)9-58-37-32(53)29(50)24(45)17(7-41)61-37/h3-6,17-20,24-27,29-43,45-48,50-56H,7-10H2,1-2H3/t17-,18-,19-,20-,24-,25-,26-,27-,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39-,40+/m1/s1 |
| InChIKey | PIFVMMPDYLWDPU-QFKVYBHTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cassia torosa (IPNI:485342-1) | seed (BTO:0001226) | PubMed (10434393) |
| Roles Classification |
|---|
| Biological Roles: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torososide B (CHEBI:66257) has functional parent physcion (CHEBI:38167) |
| torososide B (CHEBI:66257) has role anti-allergic agent (CHEBI:50857) |
| torososide B (CHEBI:66257) has role leukotriene antagonist (CHEBI:49159) |
| torososide B (CHEBI:66257) has role metabolite (CHEBI:25212) |
| torososide B (CHEBI:66257) is a monohydroxyanthraquinone (CHEBI:37483) |
| torososide B (CHEBI:66257) is a tetrasaccharide derivative (CHEBI:63567) |
| IUPAC Name |
|---|
| 8-hydroxy-3-methoxy-6-methyl-9,10-dioxo-9,10-dihydroanthracen-1-yl β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl-(1→3)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| physcion-8-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl-(1→3)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034855 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8470805 | Reaxys |
| Citations |
|---|