EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H52O25 |
| Net Charge | 0 |
| Average Mass | 932.831 |
| Monoisotopic Mass | 932.27977 |
| SMILES | [H][C@]1(O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](CO)O[C@@H](OC[C@H]2O[C@@H](Oc3cc(OC)cc4c3C(=O)c3c(O)cc(C)cc3C4=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O |
| InChI | InChI=1S/C40H52O25/c1-11-3-13-21(15(43)4-11)28(49)22-14(23(13)44)5-12(57-2)6-16(22)60-39-33(54)30(51)25(46)19(63-39)10-59-38-35(56)36(27(48)18(8-42)62-38)65-40-34(55)31(52)26(47)20(64-40)9-58-37-32(53)29(50)24(45)17(7-41)61-37/h3-6,17-20,24-27,29-43,45-48,50-56H,7-10H2,1-2H3/t17-,18-,19-,20-,24-,25-,26-,27-,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39-,40+/m1/s1 |
| InChIKey | PIFVMMPDYLWDPU-QFKVYBHTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cassia torosa (IPNI:485342-1) | seed (BTO:0001226) | PubMed (10434393) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. |
| Applications: | leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| torososide B (CHEBI:66257) has functional parent physcion (CHEBI:38167) |
| torososide B (CHEBI:66257) has role anti-allergic agent (CHEBI:50857) |
| torososide B (CHEBI:66257) has role leukotriene antagonist (CHEBI:49159) |
| torososide B (CHEBI:66257) has role metabolite (CHEBI:25212) |
| torososide B (CHEBI:66257) is a monohydroxyanthraquinone (CHEBI:37483) |
| torososide B (CHEBI:66257) is a tetrasaccharide derivative (CHEBI:63567) |
| IUPAC Name |
|---|
| 8-hydroxy-3-methoxy-6-methyl-9,10-dioxo-9,10-dihydroanthracen-1-yl β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl-(1→3)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| physcion-8-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl-(1→3)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034855 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8470805 | Reaxys |
| Citations |
|---|