EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38167 - physcion
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C16H12O5/c1-7-3-9-13(11(17)4-7)16(20)14-10(15(9)19)5-8(21-2)6-12(14)18/h3-6,17-18H,1-2H3 |
| InChIKey | FFWOKTFYGVYKIR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xanthoria parietina (ncbitaxon:107463) | - | CiteXplore (c6158) | |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| physcion (CHEBI:38167) has functional parent 2-methylanthraquinone (CHEBI:9427) |
| physcion (CHEBI:38167) has role anti-inflammatory agent (CHEBI:67079) |
| physcion (CHEBI:38167) has role antibacterial agent (CHEBI:33282) |
| physcion (CHEBI:38167) has role antifungal agent (CHEBI:35718) |
| physcion (CHEBI:38167) has role antineoplastic agent (CHEBI:35610) |
| physcion (CHEBI:38167) has role apoptosis inducer (CHEBI:68495) |
| physcion (CHEBI:38167) has role hepatoprotective agent (CHEBI:62868) |
| physcion (CHEBI:38167) has role metabolite (CHEBI:25212) |
| physcion (CHEBI:38167) is a dihydroxyanthraquinone (CHEBI:37484) |
| Incoming Relation(s) |
| physcion 8-gentiobioside (CHEBI:27598) has functional parent physcion (CHEBI:38167) |
| torososide B (CHEBI:66257) has functional parent physcion (CHEBI:38167) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-3-methoxy-6-methylanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,8-Dihydroxy-3-methoxy-6-methylanthraquinone | ChemIDplus |
| Physcione | ChemIDplus |
| 1,8-dihydroxy-3-methoxy-6-methyl-9,10-anthracenedione | ChEBI |
| 1,8-dihydroxy-3-methyl-6-methoxyanthraquinone | ChEBI |
| Emodin monomethyl ether | KEGG COMPOUND |
| parietin | ChEBI |
| UniProt Name | Source |
|---|---|
| physcion | UniProt |
| Citations |
|---|