EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38167 - physcion
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C16H12O5/c1-7-3-9-13(11(17)4-7)16(20)14-10(15(9)19)5-8(21-2)6-12(14)18/h3-6,17-18H,1-2H3 |
| InChIKey | FFWOKTFYGVYKIR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) | |
| Xanthoria parietina (ncbitaxon:107463) | - | CiteXplore (c6158) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| physcion (CHEBI:38167) has functional parent 2-methylanthraquinone (CHEBI:9427) |
| physcion (CHEBI:38167) has role anti-inflammatory agent (CHEBI:67079) |
| physcion (CHEBI:38167) has role antibacterial agent (CHEBI:33282) |
| physcion (CHEBI:38167) has role antifungal agent (CHEBI:35718) |
| physcion (CHEBI:38167) has role antineoplastic agent (CHEBI:35610) |
| physcion (CHEBI:38167) has role apoptosis inducer (CHEBI:68495) |
| physcion (CHEBI:38167) has role hepatoprotective agent (CHEBI:62868) |
| physcion (CHEBI:38167) has role metabolite (CHEBI:25212) |
| physcion (CHEBI:38167) is a dihydroxyanthraquinone (CHEBI:37484) |
| Incoming Relation(s) |
| physcion 8-gentiobioside (CHEBI:27598) has functional parent physcion (CHEBI:38167) |
| torososide B (CHEBI:66257) has functional parent physcion (CHEBI:38167) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-3-methoxy-6-methylanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,8-dihydroxy-3-methoxy-6-methyl-9,10-anthracenedione | ChEBI |
| 1,8-Dihydroxy-3-methoxy-6-methylanthraquinone | ChemIDplus |
| 1,8-dihydroxy-3-methyl-6-methoxyanthraquinone | ChEBI |
| Emodin monomethyl ether | KEGG COMPOUND |
| Parienin | KEGG COMPOUND |
| parietin | ChEBI |
| UniProt Name | Source |
|---|---|
| physcion | UniProt |
| Citations |
|---|