EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38167 - physcion
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C16H12O5/c1-7-3-9-13(11(17)4-7)16(20)14-10(15(9)19)5-8(21-2)6-12(14)18/h3-6,17-18H,1-2H3 |
| InChIKey | FFWOKTFYGVYKIR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (17125234) | |
| Xanthoria parietina (ncbitaxon:107463) | - | CiteXplore (c6158) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| physcion (CHEBI:38167) has functional parent 2-methylanthraquinone (CHEBI:9427) |
| physcion (CHEBI:38167) has role anti-inflammatory agent (CHEBI:67079) |
| physcion (CHEBI:38167) has role antibacterial agent (CHEBI:33282) |
| physcion (CHEBI:38167) has role antifungal agent (CHEBI:35718) |
| physcion (CHEBI:38167) has role antineoplastic agent (CHEBI:35610) |
| physcion (CHEBI:38167) has role apoptosis inducer (CHEBI:68495) |
| physcion (CHEBI:38167) has role hepatoprotective agent (CHEBI:62868) |
| physcion (CHEBI:38167) has role metabolite (CHEBI:25212) |
| physcion (CHEBI:38167) is a dihydroxyanthraquinone (CHEBI:37484) |
| Incoming Relation(s) |
| physcion 8-gentiobioside (CHEBI:27598) has functional parent physcion (CHEBI:38167) |
| torososide B (CHEBI:66257) has functional parent physcion (CHEBI:38167) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-3-methoxy-6-methylanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,8-dihydroxy-3-methoxy-6-methyl-9,10-anthracenedione | ChEBI |
| 1,8-Dihydroxy-3-methoxy-6-methylanthraquinone | ChemIDplus |
| 1,8-dihydroxy-3-methyl-6-methoxyanthraquinone | ChEBI |
| Emodin monomethyl ether | KEGG COMPOUND |
| Parienin | KEGG COMPOUND |
| parietin | ChEBI |
| UniProt Name | Source |
|---|---|
| physcion | UniProt |
| Citations |
|---|