EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H49N3O8S |
| Net Charge | 0 |
| Average Mass | 719.901 |
| Monoisotopic Mass | 719.32404 |
| SMILES | COC1/C=C/C=C/C=C/CC(OC(=O)C2(NC(=O)C3=CCCCC3)CC2)C(C)C(O)/C(C)=C\CCc2c(O)c(cc3c2SCC(=O)N3)NC(=O)C1 |
| InChI | InChI=1S/C39H49N3O8S/c1-24-13-12-17-28-35(46)29(22-30-36(28)51-23-33(44)41-30)40-32(43)21-27(49-3)16-10-5-4-6-11-18-31(25(2)34(24)45)50-38(48)39(19-20-39)42-37(47)26-14-8-7-9-15-26/h4-6,10-11,13-14,16,22,25,27,31,34,45-46H,7-9,12,15,17-21,23H2,1-3H3,(H,40,43)(H,41,44)(H,42,47)/b5-4+,11-6+,16-10+,24-13- |
| InChIKey | YIMYDHUFVYSTEY-WUWQZELJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (10994816) | Strain: TC 1190 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TMC-135B (CHEBI:66233) has role antimicrobial agent (CHEBI:33281) |
| TMC-135B (CHEBI:66233) has role antineoplastic agent (CHEBI:35610) |
| TMC-135B (CHEBI:66233) has role metabolite (CHEBI:25212) |
| TMC-135B (CHEBI:66233) is a cyclopropanecarboxylate ester (CHEBI:50351) |
| TMC-135B (CHEBI:66233) is a ether (CHEBI:25698) |
| TMC-135B (CHEBI:66233) is a lactam (CHEBI:24995) |
| TMC-135B (CHEBI:66233) is a macrocycle (CHEBI:51026) |
| TMC-135B (CHEBI:66233) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| TMC-135B (CHEBI:66233) is a organosulfur heterocyclic compound (CHEBI:38106) |
| TMC-135B (CHEBI:66233) is a phenols (CHEBI:33853) |
| TMC-135B (CHEBI:66233) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (11E,13E,15E,21Z)-20,26-dihydroxy-10-methoxy-19,21-dimethyl-3,8-dioxo-3,4,7,8,9,10,17,18,19,20,23,24-dodecahydro-2H-25,6-(metheno)[1,4]thiazino[3,2-d]azacyclotricosin-18-yl 1-[(cyclohex-1-en-1-ylcarbonyl)amino]cyclopropanecarboxylate |
| Synonym | Source |
|---|---|
| (6E,8E,10E,16Z)-15,28-Dihydroxy-5-methoxy-14,16-dimethyl-3,24-dioxo-22-thia-2,25-diazatricyclo[18.7.1.021,26]octacosa-1(28),6,8,10,16,20,26-heptaen-13-yl 1-[(1-cyclohexen-1-ylcarbonyl)amino]cyclopropanecarboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8670452 | Reaxys |
| Citations |
|---|