EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@H](CCO)[C@@]1(C)CCC[C@@]2(C)CO |
| InChI | InChI=1S/C16H30O3/c1-14(11-18)7-4-8-15(2)12(14)5-9-16(3,19)13(15)6-10-17/h12-13,17-19H,4-11H2,1-3H3/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | OSLJXGPVHCLGHU-XFIYOXNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crassocephalum mannii (IPNI:199508-1) | aerial part (BTO:0001658) | PubMed (18473477) |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14,15,16-tetranorlabdane-8α,12,18-triol (CHEBI:66217) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| 13,14,15,16-tetranorlabdane-8α,12,18-triol (CHEBI:66217) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| 13,14,15,16-tetranorlabdane-8α,12,18-triol (CHEBI:66217) has role plant metabolite (CHEBI:76924) |
| 13,14,15,16-tetranorlabdane-8α,12,18-triol (CHEBI:66217) is a diterpenoid (CHEBI:23849) |
| 13,14,15,16-tetranorlabdane-8α,12,18-triol (CHEBI:66217) is a tertiary alcohol (CHEBI:26878) |
| 13,14,15,16-tetranorlabdane-8α,12,18-triol (CHEBI:66217) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,2R,4aR,5R,8aS)-1-(2-hydroxyethyl)-5-(hydroxymethyl)-2,5,8a-trimethyldecahydronaphthalen-2-ol |
| Citations |
|---|