EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O9 |
| Net Charge | 0 |
| Average Mass | 416.382 |
| Monoisotopic Mass | 416.11073 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(-c4ccc(O)cc4)coc3c2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20O9/c1-9-17(24)19(26)20(27)21(29-9)30-12-6-14(23)16-15(7-12)28-8-13(18(16)25)10-2-4-11(22)5-3-10/h2-9,17,19-24,26-27H,1H3/t9-,17+,19+,20+,21-/m0/s1 |
| InChIKey | YRHHFFMCCMEVTR-GBXJYZSASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora kifunensis (ncbitaxon:58351) | - | PubMed (17191679) | Strain: MJM 341 |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talosin A (CHEBI:66186) has functional parent genistein (CHEBI:28088) |
| talosin A (CHEBI:66186) has role anti-inflammatory agent (CHEBI:67079) |
| talosin A (CHEBI:66186) has role antifungal agent (CHEBI:35718) |
| talosin A (CHEBI:66186) has role metabolite (CHEBI:25212) |
| talosin A (CHEBI:66186) has role NF-κB inhibitor (CHEBI:73240) |
| talosin A (CHEBI:66186) is a glycosyloxyisoflavone (CHEBI:74630) |
| talosin A (CHEBI:66186) is a hydroxyisoflavone (CHEBI:38755) |
| talosin A (CHEBI:66186) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-deoxy-α-L-talopyranoside |
| Synonym | Source |
|---|---|
| genistein-7-α-L-6-deoxy-talopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11280209 | Reaxys |
| Citations |
|---|