EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O9 |
| Net Charge | 0 |
| Average Mass | 416.382 |
| Monoisotopic Mass | 416.11073 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(-c4ccc(O)cc4)coc3c2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20O9/c1-9-17(24)19(26)20(27)21(29-9)30-12-6-14(23)16-15(7-12)28-8-13(18(16)25)10-2-4-11(22)5-3-10/h2-9,17,19-24,26-27H,1H3/t9-,17+,19+,20+,21-/m0/s1 |
| InChIKey | YRHHFFMCCMEVTR-GBXJYZSASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora kifunensis (ncbitaxon:58351) | - | PubMed (17191679) | Strain: MJM 341 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talosin A (CHEBI:66186) has functional parent genistein (CHEBI:28088) |
| talosin A (CHEBI:66186) has role anti-inflammatory agent (CHEBI:67079) |
| talosin A (CHEBI:66186) has role antifungal agent (CHEBI:35718) |
| talosin A (CHEBI:66186) has role metabolite (CHEBI:25212) |
| talosin A (CHEBI:66186) has role NF-κB inhibitor (CHEBI:73240) |
| talosin A (CHEBI:66186) is a glycosyloxyisoflavone (CHEBI:74630) |
| talosin A (CHEBI:66186) is a hydroxyisoflavone (CHEBI:38755) |
| talosin A (CHEBI:66186) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-deoxy-α-L-talopyranoside |
| Synonym | Source |
|---|---|
| genistein-7-α-L-6-deoxy-talopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11280209 | Reaxys |
| Citations |
|---|