EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48N2O7 |
| Net Charge | 0 |
| Average Mass | 548.721 |
| Monoisotopic Mass | 548.34615 |
| SMILES | C=C(CC/C=C/C=C/CC(C)CC(=O)CC(O)CNC(=O)C(C)C(C)OC(N)=O)CC(C)C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C30H48N2O7/c1-20(14-22(3)15-23(4)17-28(35)36)12-10-8-7-9-11-13-21(2)16-26(33)18-27(34)19-32-29(37)24(5)25(6)39-30(31)38/h7-9,11,17,21-22,24-25,27,34H,1,10,12-16,18-19H2,2-6H3,(H2,31,38)(H,32,37)(H,35,36)/b8-7+,11-9+,23-17+ |
| InChIKey | GENAAYFYLGYPIQ-FFPWVZAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alcaligenes sp. (ncbitaxon:512) | - | PubMed (8621352) | Strain: YL 02632S |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kalimantacin B (CHEBI:66136) has role antibacterial agent (CHEBI:33282) |
| kalimantacin B (CHEBI:66136) has role antimicrobial agent (CHEBI:33281) |
| kalimantacin B (CHEBI:66136) has role bacterial metabolite (CHEBI:76969) |
| kalimantacin B (CHEBI:66136) is a carbamate ester (CHEBI:23003) |
| kalimantacin B (CHEBI:66136) is a fatty acid derivative (CHEBI:61697) |
| kalimantacin B (CHEBI:66136) is a secondary carboxamide (CHEBI:140325) |
| kalimantacin B (CHEBI:66136) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E,10E,12E)-20-{[3-(carbamoyloxy)-2-methylbutanoyl]amino}-19-hydroxy-3,5,15-trimethyl-7-methylidene-17-oxoicosa-2,10,12-trienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21369092 | Reaxys |
| Citations |
|---|