EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37NO5 |
| Net Charge | 0 |
| Average Mass | 479.617 |
| Monoisotopic Mass | 479.26717 |
| SMILES | [H][C@]12CCc3ccc(O)c(c3)-c3cc(ccc3OC)CC[C@H](OC(C)=O)C[C@@]3([H])CCC[C@]([H])(C1)N3CO2 |
| InChI | InChI=1S/C29H37NO5/c1-19(31)35-25-11-7-21-9-13-29(33-2)27(15-21)26-14-20(8-12-28(26)32)6-10-24-16-22-4-3-5-23(17-25)30(22)18-34-24/h8-9,12-15,22-25,32H,3-7,10-11,16-18H2,1-2H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | YODZWLPSGSZPHZ-NGSHPTGOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lythramine (CHEBI:6610) has functional parent lythranidine (CHEBI:36284) |
| lythramine (CHEBI:6610) is a piperidine alkaloid (CHEBI:26147) |
| IUPAC Name |
|---|
| (9S,13R,17R,19S)-3-hydroxy-25-methoxy-10-oxa-12-azapentacyclo[20.3.1.12,6.19,13.012,17]octacosa-1(26),2(28),3,5,22,24-hexaen-19-yl acetate |
| Synonym | Source |
|---|---|
| Lythramine | KEGG COMPOUND |
| Citations |
|---|