EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H35NO4 |
| Net Charge | 0 |
| Average Mass | 425.569 |
| Monoisotopic Mass | 425.25661 |
| SMILES | [H][C@@]12CCC[C@]([H])(C[C@@H](O)CCc3ccc(OC)c(c3)-c3cc(ccc3O)CC[C@H](O)C1)N2 |
| InChI | InChI=1S/C26H35NO4/c1-31-26-12-8-18-6-10-22(29)16-20-4-2-3-19(27-20)15-21(28)9-5-17-7-11-25(30)23(13-17)24(26)14-18/h7-8,11-14,19-22,27-30H,2-6,9-10,15-16H2,1H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | IMHNVGKPQLKSHM-CZYKHXBRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lythranidine (CHEBI:36284) is a piperidine alkaloid (CHEBI:26147) |
| lythranidine (CHEBI:36284) is a piperidine alkaloid fundamental parent (CHEBI:38529) |
| Incoming Relation(s) |
| lythramine (CHEBI:6610) has functional parent lythranidine (CHEBI:36284) |
| IUPAC Name |
|---|
| lythranidine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1555440 | Beilstein |
| CAS:70832-04-1 | ChemIDplus |