EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | [H][C@@]1(c2c(O)c(O)c3oc(-c4ccc(O)cc4)cc(=O)c3c2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O11/c22-6-11-14(25)17(28)19(30)21(32-11)13-15(26)12-9(24)5-10(7-1-3-8(23)4-2-7)31-20(12)18(29)16(13)27/h1-5,11,14,17,19,21-23,25-30H,6H2/t11-,14-,17+,19-,21+/m1/s1 |
| InChIKey | RKEQWDAUYLDNEU-DSTJRUDUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Iris pseudopumila (IPNI:438994-1) | rhizome (BTO:0001181) | PubMed (17315314) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoscutellarein glycoside (CHEBI:66085) has functional parent isoscutellarein (CHEBI:6059) |
| isoscutellarein glycoside (CHEBI:66085) has role antioxidant (CHEBI:22586) |
| isoscutellarein glycoside (CHEBI:66085) has role metabolite (CHEBI:25212) |
| isoscutellarein glycoside (CHEBI:66085) is a C-glycosyl compound (CHEBI:20857) |
| isoscutellarein glycoside (CHEBI:66085) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[5,7,8-trihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-6-yl]-D-glucitol |
| Synonym | Source |
|---|---|
| isoscutellarein-6-C-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11109929 | Reaxys |
| Citations |
|---|