EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(O)c(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)12-6-10(18)13-9(17)5-11(19)14(20)15(13)21-12/h1-6,16-17,19-20H |
| InChIKey | NXHQVROAKYDSNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoscutellarein (CHEBI:6059) has functional parent apigenin (CHEBI:18388) |
| isoscutellarein (CHEBI:6059) has role metabolite (CHEBI:25212) |
| isoscutellarein (CHEBI:6059) is a tetrahydroxyflavone (CHEBI:38684) |
| Incoming Relation(s) |
| isoscutellarein glycoside (CHEBI:66085) has functional parent isoscutellarein (CHEBI:6059) |
| IUPAC Name |
|---|
| 5,7,8-trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 8-Hydroxyapigenin | KEGG COMPOUND |
| Isoscutellarein | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003848 | KNApSAcK |
| C10097 | KEGG COMPOUND |
| LMPK12111361 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:304400 | Reaxys |
| CAS:41440-05-5 | KEGG COMPOUND |
| Citations |
|---|