EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O6 |
| Net Charge | 0 |
| Average Mass | 430.541 |
| Monoisotopic Mass | 430.23554 |
| SMILES | C=C(C=O)[C@@H]1C[C@@]2(C)C(=CC1=O)[C@H](OC(=O)/C(C)=C/[C@@H](C)CCCC)CC[C@@H]2C(=O)O |
| InChI | InChI=1S/C25H34O6/c1-6-7-8-15(2)11-16(3)24(30)31-22-10-9-19(23(28)29)25(5)13-18(17(4)14-26)21(27)12-20(22)25/h11-12,14-15,18-19,22H,4,6-10,13H2,1-3,5H3,(H,28,29)/b16-11+/t15-,18-,19+,22+,25+/m0/s1 |
| InChIKey | UIXJDFDDMXCJCT-DVRXSGNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | DOI (10.1016/S0040-4039(99)01878-X) | Strain: MF 6254 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| integric acid (CHEBI:66081) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| integric acid (CHEBI:66081) has role metabolite (CHEBI:25212) |
| integric acid (CHEBI:66081) is a carboxylic ester (CHEBI:33308) |
| integric acid (CHEBI:66081) is a cyclic ketone (CHEBI:3992) |
| integric acid (CHEBI:66081) is a dioxo monocarboxylic acid (CHEBI:35951) |
| integric acid (CHEBI:66081) is a enal (CHEBI:51688) |
| integric acid (CHEBI:66081) is a enone (CHEBI:51689) |
| integric acid (CHEBI:66081) is a eremophilane sesquiterpenoid (CHEBI:36753) |
| IUPAC Name |
|---|
| (1S,4R,7S,8aR)-4-{[(2E,4S)-2,4-dimethyloct-2-enoyl]oxy}-8a-methyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-1,2,3,4,6,7,8,8a-octahydronaphthalene-1-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19897595 | Reaxys |
| Citations |
|---|