EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O6 |
| Net Charge | 0 |
| Average Mass | 430.541 |
| Monoisotopic Mass | 430.23554 |
| SMILES | C=C(C=O)[C@@H]1C[C@@]2(C)C(=CC1=O)[C@H](OC(=O)/C(C)=C/[C@@H](C)CCCC)CC[C@@H]2C(=O)O |
| InChI | InChI=1S/C25H34O6/c1-6-7-8-15(2)11-16(3)24(30)31-22-10-9-19(23(28)29)25(5)13-18(17(4)14-26)21(27)12-20(22)25/h11-12,14-15,18-19,22H,4,6-10,13H2,1-3,5H3,(H,28,29)/b16-11+/t15-,18-,19+,22+,25+/m0/s1 |
| InChIKey | UIXJDFDDMXCJCT-DVRXSGNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | DOI (10.1016/S0040-4039(99)01878-X) | Strain: MF 6254 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| integric acid (CHEBI:66081) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| integric acid (CHEBI:66081) has role metabolite (CHEBI:25212) |
| integric acid (CHEBI:66081) is a carboxylic ester (CHEBI:33308) |
| integric acid (CHEBI:66081) is a cyclic ketone (CHEBI:3992) |
| integric acid (CHEBI:66081) is a dioxo monocarboxylic acid (CHEBI:35951) |
| integric acid (CHEBI:66081) is a enal (CHEBI:51688) |
| integric acid (CHEBI:66081) is a enone (CHEBI:51689) |
| integric acid (CHEBI:66081) is a eremophilane sesquiterpenoid (CHEBI:36753) |
| IUPAC Name |
|---|
| (1S,4R,7S,8aR)-4-{[(2E,4S)-2,4-dimethyloct-2-enoyl]oxy}-8a-methyl-6-oxo-7-(3-oxoprop-1-en-2-yl)-1,2,3,4,6,7,8,8a-octahydronaphthalene-1-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19897595 | Reaxys |
| Citations |
|---|