EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])CC[C@@]1(C)[C@H](O)CC[C@@](C)(O)[C@]21[H] |
| InChI | InChI=1S/C15H22O4/c1-8-9-4-6-14(2)10(16)5-7-15(3,18)12(14)11(9)19-13(8)17/h9-12,16,18H,1,4-7H2,2-3H3/t9-,10+,11-,12+,14-,15+/m0/s1 |
| InChIKey | LVABKRFKENTQBT-SYPGZIFDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saussurea lappa (ncbitaxon:324593) | root (BTO:0001188) | PubMed (18409040) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1β-hydroxy arbusculin A (CHEBI:66024) has functional parent arbusculin A (CHEBI:2805) |
| 1β-hydroxy arbusculin A (CHEBI:66024) has role melanin synthesis inhibitor (CHEBI:64933) |
| 1β-hydroxy arbusculin A (CHEBI:66024) has role metabolite (CHEBI:25212) |
| 1β-hydroxy arbusculin A (CHEBI:66024) is a diol (CHEBI:23824) |
| 1β-hydroxy arbusculin A (CHEBI:66024) is a organic heterotricyclic compound (CHEBI:26979) |
| 1β-hydroxy arbusculin A (CHEBI:66024) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3aS,5aR,6R,9R,9aS,9bS)-6,9-dihydroxy-5a,9-dimethyl-3-methylidenedecahydronaphtho[1,2-b]furan-2(3H)-one |
| Manual Xrefs | Databases |
|---|---|
| 4476767 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1247707 | Reaxys |
| Citations |
|---|