EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])CC[C@@]1(C)CCC[C@@](C)(O)[C@@]12[H] |
| InChI | InChI=1S/C15H22O3/c1-9-10-5-8-14(2)6-4-7-15(3,17)12(14)11(10)18-13(9)16/h10-12,17H,1,4-8H2,2-3H3/t10-,11-,12+,14+,15+/m0/s1 |
| InChIKey | BVRDNJZFYKHRJQ-CWFCOSEVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | melanin synthesis inhibitor A depigmentation agent which inhibits the synthesis of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arbusculin A (CHEBI:2805) has role melanin synthesis inhibitor (CHEBI:64933) |
| arbusculin A (CHEBI:2805) has role metabolite (CHEBI:25212) |
| arbusculin A (CHEBI:2805) is a organic heterotricyclic compound (CHEBI:26979) |
| arbusculin A (CHEBI:2805) is a sesquiterpene lactone (CHEBI:37667) |
| arbusculin A (CHEBI:2805) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| 1β-hydroxy arbusculin A (CHEBI:66024) has functional parent arbusculin A (CHEBI:2805) |
| IUPAC Name |
|---|
| (3aS,5aR,9R,9aS,9bS)-9-hydroxy-5a,9-dimethyl-3-methylidenedecahydronaphtho[1,2-b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| Arbusculin A | KEGG COMPOUND |
| 4-epiarbusculin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1620688 | Reaxys |
| CAS:27652-22-8 | KEGG COMPOUND |
| CAS:27652-22-8 | ChemIDplus |
| Citations |
|---|