EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H50O9 |
| Net Charge | 0 |
| Average Mass | 674.831 |
| Monoisotopic Mass | 674.34548 |
| SMILES | [H][C@]12C[C@]3([H])C(C)(C)O[C@](C/C=C(\C)C(=O)O)(C1=O)[C@@]31Oc3c(c(O)c4c(c3C(C)(C)C=C)OC(C)(C)C3CCC(C)=CC43)C(=O)C1C2OCC |
| InChI | InChI=1S/C40H50O9/c1-11-36(5,6)28-32-25(21-17-19(3)13-14-23(21)37(7,8)47-32)29(41)26-30(42)27-31(46-12-2)22-18-24-38(9,10)49-39(34(22)43,16-15-20(4)35(44)45)40(24,27)48-33(26)28/h11,15,17,21-24,27,31,41H,1,12-14,16,18H2,2-10H3,(H,44,45)/b20-15+/t21?,22-,23?,24-,27?,31?,39-,40-/m1/s1 |
| InChIKey | DDXYKUAYCPOGSR-BJBPENEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia gaudichaudii (IPNI:427963-1) | bark (BTO:0001301) | PubMed (11101460) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gaudichaudiic acid F (CHEBI:65950) has role antineoplastic agent (CHEBI:35610) |
| gaudichaudiic acid F (CHEBI:65950) has role metabolite (CHEBI:25212) |
| gaudichaudiic acid F (CHEBI:65950) is a bridged compound (CHEBI:35990) |
| gaudichaudiic acid F (CHEBI:65950) is a cyclic ether (CHEBI:37407) |
| gaudichaudiic acid F (CHEBI:65950) is a cyclic ketone (CHEBI:3992) |
| gaudichaudiic acid F (CHEBI:65950) is a organic heteroheptacyclic compound (CHEBI:52157) |
| gaudichaudiic acid F (CHEBI:65950) is a oxo monocarboxylic acid (CHEBI:35871) |
| gaudichaudiic acid F (CHEBI:65950) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-4-[(1S,3aR,5R,16aR)-6-ethoxy-8-hydroxy-3,3,10,13,13-pentamethyl-15-(2-methylbut-3-en-2-yl)-7,17-dioxo-3a,4,5,6,6a,7,11,12,12a,13-decahydro-3H,8bH-1,5-methanofuro[3,4-g]isochromeno[4,3-b]xanthen-1-yl]-2-methylbut-2-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8750194 | Reaxys |
| Citations |
|---|