EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H58O9 |
| Net Charge | 0 |
| Average Mass | 646.862 |
| Monoisotopic Mass | 646.40808 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@@H](C/C=C/C(C)(C)O)C(=O)O[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@]1(C)CC[C@@H](OC(C)=O)C2(C)C |
| InChI | InChI=1S/C37H58O9/c1-21(38)45-28-15-17-35(6)24-14-19-36(7)23(13-18-37(36,8)25(24)11-12-27(35)34(28,4)5)22(10-9-16-33(2,3)43)31(42)46-32-30(41)29(40)26(39)20-44-32/h9,16,22-23,26-30,32,39-41,43H,10-15,17-20H2,1-8H3/b16-9+/t22-,23-,26-,27+,28-,29+,30-,32+,35-,36-,37+/m1/s1 |
| InChIKey | SZJHDEBBAHZWAS-JYUDEBFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fomitopsis pinicola (ncbitaxon:40483) | fruit body (BTO:0000487) | PubMed (15679320) |
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fomitoside E (CHEBI:65903) has parent hydride lanostane (CHEBI:20265) |
| fomitoside E (CHEBI:65903) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| fomitoside E (CHEBI:65903) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| fomitoside E (CHEBI:65903) has role fungal metabolite (CHEBI:76946) |
| fomitoside E (CHEBI:65903) is a acetate ester (CHEBI:47622) |
| fomitoside E (CHEBI:65903) is a secondary alcohol (CHEBI:35681) |
| fomitoside E (CHEBI:65903) is a tetracyclic triterpenoid (CHEBI:26893) |
| fomitoside E (CHEBI:65903) is a triterpenoid saponin (CHEBI:61778) |
| fomitoside E (CHEBI:65903) is a β-D-xyloside (CHEBI:27926) |
| IUPAC Name |
|---|
| 1-O-[(3α,23E)-3-acetoxy-25-hydroxy-21-oxolanosta-8,23-dien-21-yl]-β-D-xylopyranose |
| Synonym | Source |
|---|---|
| 25-hydroxy-3α-acetoxylanost-8,23-dien-21-oicacid 21-O-β-D-xylopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10231343 | Reaxys |
| Citations |
|---|