EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O12 |
| Net Charge | 0 |
| Average Mass | 464.379 |
| Monoisotopic Mass | 464.09548 |
| SMILES | O=C1C[C@H](c2ccc(O)c(O)c2)Oc2cc(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c21 |
| InChI | InChI=1S/C21H20O12/c22-9-2-1-7(3-10(9)23)13-6-12(25)15-11(24)4-8(5-14(15)32-13)31-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-5,13,16-19,21-24,26-28H,6H2,(H,29,30)/t13-,16+,17+,18-,19+,21-/m1/s1 |
| InChIKey | YSORAXGDTRAEMV-ZJIWIORTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chrysanthemum indicum (ncbitaxon:146995) | flower (BTO:0000469) | PubMed (12130858) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) has role metabolite (CHEBI:25212) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) is a β-D-glucosiduronic acid (CHEBI:15341) |
| IUPAC Name |
|---|
| (2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-3,4-dihydro-2H-chromen-7-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| eriodictyol 7-glucuronide | ChemIDplus |
| (R)-2-(3,4-dihydroxyphenyl)-2,4-dihydro-5-hydroxy-4-oxo-2H-1-benzopyran-7-yl β-D-glucopyranosiduronic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9239386 | Reaxys |
| CAS:133360-47-1 | ChemIDplus |
| Citations |
|---|