EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O12 |
| Net Charge | 0 |
| Average Mass | 464.379 |
| Monoisotopic Mass | 464.09548 |
| SMILES | O=C1C[C@H](c2ccc(O)c(O)c2)Oc2cc(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c21 |
| InChI | InChI=1S/C21H20O12/c22-9-2-1-7(3-10(9)23)13-6-12(25)15-11(24)4-8(5-14(15)32-13)31-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-5,13,16-19,21-24,26-28H,6H2,(H,29,30)/t13-,16+,17+,18-,19+,21-/m1/s1 |
| InChIKey | YSORAXGDTRAEMV-ZJIWIORTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chrysanthemum indicum (ncbitaxon:146995) | flower (BTO:0000469) | PubMed (12130858) |
| Roles Classification |
|---|
| Biological Roles: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) has role metabolite (CHEBI:25212) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) is a 3'-hydroxyflavonoid (CHEBI:27741) |
| (2R)-eriodictoyl-7-O-β-D-glucopyranosiduronic acid (CHEBI:65860) is a β-D-glucosiduronic acid (CHEBI:15341) |
| IUPAC Name |
|---|
| (2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-3,4-dihydro-2H-chromen-7-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| eriodictyol 7-glucuronide | ChemIDplus |
| (R)-2-(3,4-dihydroxyphenyl)-2,4-dihydro-5-hydroxy-4-oxo-2H-1-benzopyran-7-yl β-D-glucopyranosiduronic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9239386 | Reaxys |
| CAS:133360-47-1 | ChemIDplus |
| Citations |
|---|