EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@@]12C[C@@]3(C)CCC[C@H](C)[C@@]34O[C@H]4[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C15H20O3/c1-8-5-4-6-14(3)7-10-11(9(2)13(16)17-10)12-15(8,14)18-12/h8,10-12H,2,4-7H2,1,3H3/t8-,10+,11+,12-,14+,15-/m0/s1 |
| InChIKey | YIQKVCDNUFDAHB-HKKVUVRFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula helenium (ncbitaxon:55635) | root (BTO:0001188) | PubMed (10364842) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-epoxyalantolactone (CHEBI:65856) has functional parent alantolactone (CHEBI:2540) |
| 5α-epoxyalantolactone (CHEBI:65856) has role antimycobacterial drug (CHEBI:64912) |
| 5α-epoxyalantolactone (CHEBI:65856) has role metabolite (CHEBI:25212) |
| 5α-epoxyalantolactone (CHEBI:65856) is a epoxide (CHEBI:32955) |
| 5α-epoxyalantolactone (CHEBI:65856) is a naphthofuran (CHEBI:39270) |
| 5α-epoxyalantolactone (CHEBI:65856) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (1aR,2S,5aR,6aR,9aR,9bS)-2,5a-dimethyl-9-methylideneoctahydro-2H-oxireno[4,4a]naphtho[2,3-b]furan-8(9H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5031399 | Reaxys |
| Citations |
|---|