EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | [H][C@@]12C[C@@]3(C)CCC[C@H](C)C3=C[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C15H20O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h7,9,11,13H,2,4-6,8H2,1,3H3/t9-,11+,13+,15+/m0/s1 |
| InChIKey | PXOYOCNNSUAQNS-AGNJHWRGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula helenium (ncbitaxon:55635) | - | PubMed (24996657) | |
| Saussurea lappa (ncbitaxon:324593) | - | PubMed (25068579) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alantolactone (CHEBI:2540) has role antineoplastic agent (CHEBI:35610) |
| alantolactone (CHEBI:2540) has role apoptosis inducer (CHEBI:68495) |
| alantolactone (CHEBI:2540) has role plant metabolite (CHEBI:76924) |
| alantolactone (CHEBI:2540) is a naphthofuran (CHEBI:39270) |
| alantolactone (CHEBI:2540) is a olefinic compound (CHEBI:78840) |
| alantolactone (CHEBI:2540) is a sesquiterpene lactone (CHEBI:37667) |
| Incoming Relation(s) |
| 5α-epoxyalantolactone (CHEBI:65856) has functional parent alantolactone (CHEBI:2540) |
| IUPAC Name |
|---|
| (3aR,5S,8aR,9aR)-5,8a-dimethyl-3-methylidene-3a,5,6,7,8,8a,9,9a-octahydronaphtho[2,3-b]furan-2(3H)-one |
| Synonyms | Source |
|---|---|
| Alantolactone | KEGG COMPOUND |
| Elecampane camphor | ChemIDplus |
| Alant camphor | ChemIDplus |
| Inula camphor | ChemIDplus |
| Eupatal | ChemIDplus |
| Helenine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09289 | KEGG COMPOUND |
| C00012893 | KNApSAcK |
| LMPR0103190013 | LIPID MAPS |
| HMDB0035906 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5266481 | Reaxys |
| CAS:546-43-0 | KEGG COMPOUND |
| CAS:546-43-0 | ChemIDplus |
| Citations |
|---|