EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O3 |
| Net Charge | 0 |
| Average Mass | 442.684 |
| Monoisotopic Mass | 442.34470 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)[C@@]3([H])C[C@]3([H])[C@H](C)C(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](O)C[C@]34C=C[C@]21OO4 |
| InChI | InChI=1S/C29H46O3/c1-17(2)18(3)21-15-22(21)19(4)23-7-8-24-26(23,5)11-10-25-27(6)12-9-20(30)16-28(27)13-14-29(24,25)32-31-28/h13-14,17-25,30H,7-12,15-16H2,1-6H3/t18-,19-,20+,21-,22-,23-,24-,25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | FYNMKNFAKCHMLL-PPXWZDJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia (ncbitaxon:51814) | - | PubMed (10650100) |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α,8α-epidioxysterol (CHEBI:65853) has role antineoplastic agent (CHEBI:35610) |
| 5α,8α-epidioxysterol (CHEBI:65853) has role metabolite (CHEBI:25212) |
| 5α,8α-epidioxysterol (CHEBI:65853) is a 3β-sterol (CHEBI:35348) |
| 5α,8α-epidioxysterol (CHEBI:65853) is a cyclopropanes (CHEBI:51454) |
| 5α,8α-epidioxysterol (CHEBI:65853) is a organic peroxide (CHEBI:25702) |
| IUPAC Name |
|---|
| (3S,5S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-[(1R)-1-{(1R,2R)-2-[(2R)-3-methylbutan-2-yl]cyclopropyl}ethyl]-1,3,4,9,10,11,12,13,14,15,16,17-dodecahydro-2H-5,8-epidioxycyclopenta[a]phenanthren-3-ol |
| Synonym | Source |
|---|---|
| 22R,23R,24R-5α,8α-epidioxy-22,23-methylene-24-methylcholest-6-en-3β-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20596441 | Reaxys |
| Citations |
|---|