EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](O)C[C@]34C=C[C@]21OO4 |
| InChI | InChI=1S/C27H44O3/c1-18(2)7-6-8-19(3)21-9-10-22-24(21,4)13-12-23-25(5)14-11-20(28)17-26(25)15-16-27(22,23)30-29-26/h15-16,18-23,28H,6-14,17H2,1-5H3/t19-,20+,21-,22-,23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | FOISYVRNZSWLHL-MEKQHADNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diadema setosum (ncbitaxon:31175) | body wall (BTO:0000139) | PubMed (15357000) |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α,8α-epidioxycholest-6-en-3β-ol (CHEBI:65851) has role antineoplastic agent (CHEBI:35610) |
| 5α,8α-epidioxycholest-6-en-3β-ol (CHEBI:65851) has role metabolite (CHEBI:25212) |
| 5α,8α-epidioxycholest-6-en-3β-ol (CHEBI:65851) is a 3β-sterol (CHEBI:35348) |
| 5α,8α-epidioxycholest-6-en-3β-ol (CHEBI:65851) is a cholestanoid (CHEBI:50401) |
| 5α,8α-epidioxycholest-6-en-3β-ol (CHEBI:65851) is a organic peroxide (CHEBI:25702) |
| IUPAC Name |
|---|
| (3S,5S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,3,4,9,10,11,12,13,14,15,16,17-dodecahydro-2H-5,8-epidioxycyclopenta[a]phenanthren-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 9604856 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:46010 | Reaxys |
| Citations |
|---|