EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H][C@]1([C@@H](C)CCC=C(C)C)C[C@@H]2OO[C@H]1C=C2C |
| InChI | InChI=1S/C15H24O2/c1-10(2)6-5-7-11(3)13-9-14-12(4)8-15(13)17-16-14/h6,8,11,13-15H,5,7,9H2,1-4H3/t11-,13+,14-,15-/m0/s1 |
| InChIKey | LJPSCRDRIZSODI-ATGSNQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia densibracteata (IPNI:871940-1) | - | DOI (10.1016/S0031-9422(96)00863-1) | |
| Artemisia selengensis (ncbitaxon:637485) | - | Article (J PHARMACOGN, 1993, 24, 107) | |
| Artemisia stolonifera (ncbitaxon:637488) | aerial part (BTO:0001658) | PubMed (10836741) | |
| Eupatorium rufescens (IPNI:206830-1) | - | PubMed (17252501) | |
| Senecio selloi (ncbitaxon:462559) | - | PubMed (17252501) |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1R,4S,6R-1,4-endoperoxy-bisabola-2,10-diene (CHEBI:65845) has parent hydride bisabolane (CHEBI:36480) |
| 1R,4S,6R-1,4-endoperoxy-bisabola-2,10-diene (CHEBI:65845) has role antineoplastic agent (CHEBI:35610) |
| 1R,4S,6R-1,4-endoperoxy-bisabola-2,10-diene (CHEBI:65845) has role antiplasmodial drug (CHEBI:64915) |
| 1R,4S,6R-1,4-endoperoxy-bisabola-2,10-diene (CHEBI:65845) has role metabolite (CHEBI:25212) |
| 1R,4S,6R-1,4-endoperoxy-bisabola-2,10-diene (CHEBI:65845) is a organic peroxide (CHEBI:25702) |
| 1R,4S,6R-1,4-endoperoxy-bisabola-2,10-diene (CHEBI:65845) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1R,4S,7R)-5-methyl-7-[(2S)-6-methylhept-5-en-2-yl]-2,3-dioxabicyclo[2.2.2]oct-5-ene |
| Citations |
|---|