EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12O9 |
| Net Charge | 0 |
| Average Mass | 372.285 |
| Monoisotopic Mass | 372.04813 |
| SMILES | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
| InChI | InChI=1S/C18H12O9/c19-7-1-8(20)3-10(2-7)25-16-12(23)6-13(24)17-18(16)27-15-11(22)4-9(21)5-14(15)26-17/h1-6,19-24H |
| InChIKey | PCZZRBGISTUIOA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ecklonia cava (ncbitaxon:105407) | - | PubMed (19201199) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Applications: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eckol (CHEBI:65819) has functional parent phloroglucinol (CHEBI:16204) |
| eckol (CHEBI:65819) has role antioxidant (CHEBI:22586) |
| eckol (CHEBI:65819) has role metabolite (CHEBI:25212) |
| eckol (CHEBI:65819) is a phlorotannin (CHEBI:71222) |
| Incoming Relation(s) |
| 7-phloroeckol (CHEBI:65790) has functional parent eckol (CHEBI:65819) |
| IUPAC Name |
|---|
| 4-(3,5-dihydroxyphenoxy)oxanthrene-1,3,6,8-tetrol |
| Synonyms | Source |
|---|---|
| 4-(3,5-dihydroxyphenoxy)dibenzo-p-dioxin-1,3,6,8-tetrol | ChEBI |
| 4-(3,5-dihydroxyphenoxy)-dibenzo(b,e)(1,4)dioxin-1,3,6,8-tetrol | ChEBI |
| 1-(3,5-dihydroxyphenoxy)-2,4,7,9-tetrahydroxydibenzo-1,4-dioxin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Eckol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3635964 | Reaxys |
| CAS:88798-74-7 | ChemIDplus |
| Citations |
|---|