EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H16O12 |
| Net Charge | 0 |
| Average Mass | 496.380 |
| Monoisotopic Mass | 496.06418 |
| SMILES | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(Oc4c(O)cc(O)cc4O)cc2O3)c1 |
| InChI | InChI=1S/C24H16O12/c25-9-1-10(26)3-12(2-9)34-22-17(31)8-18(32)23-24(22)36-21-16(30)6-13(7-19(21)35-23)33-20-14(28)4-11(27)5-15(20)29/h1-8,25-32H |
| InChIKey | JLEVVQRBEATTCM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ecklonia cava (ncbitaxon:105407) | - | PubMed (19201199) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Applications: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-phloroeckol (CHEBI:65790) has functional parent eckol (CHEBI:65819) |
| 7-phloroeckol (CHEBI:65790) has functional parent phloroglucinol (CHEBI:16204) |
| 7-phloroeckol (CHEBI:65790) has role antioxidant (CHEBI:22586) |
| 7-phloroeckol (CHEBI:65790) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| 7-phloroeckol (CHEBI:65790) has role metabolite (CHEBI:25212) |
| 7-phloroeckol (CHEBI:65790) is a aromatic ether (CHEBI:35618) |
| 7-phloroeckol (CHEBI:65790) is a phlorotannin (CHEBI:71222) |
| IUPAC Name |
|---|
| 4-(3,5-dihydroxyphenoxy)-8-(2,4,6-trihydroxyphenoxy)oxanthrene-1,3,6-triol |
| Synonym | Source |
|---|---|
| 1-(3',5'-dihydroxyphenoxy)-7-(2'',4'',6''-trihydroxyphenoxy)-2,4,9-trihydroxydibenzo-1,4-dioxin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 7-Phloroeckol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9974456 | Reaxys |
| Citations |
|---|