EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H16O12 |
| Net Charge | 0 |
| Average Mass | 496.380 |
| Monoisotopic Mass | 496.06418 |
| SMILES | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(Oc4c(O)cc(O)cc4O)cc2O3)c1 |
| InChI | InChI=1S/C24H16O12/c25-9-1-10(26)3-12(2-9)34-22-17(31)8-18(32)23-24(22)36-21-16(30)6-13(7-19(21)35-23)33-20-14(28)4-11(27)5-15(20)29/h1-8,25-32H |
| InChIKey | JLEVVQRBEATTCM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ecklonia cava (ncbitaxon:105407) | - | PubMed (19201199) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 3.1.1.3 (triacylglycerol lipase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of triacylglycerol lipase (EC 3.1.1.3). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| Applications: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-phloroeckol (CHEBI:65790) has functional parent eckol (CHEBI:65819) |
| 7-phloroeckol (CHEBI:65790) has functional parent phloroglucinol (CHEBI:16204) |
| 7-phloroeckol (CHEBI:65790) has role antioxidant (CHEBI:22586) |
| 7-phloroeckol (CHEBI:65790) has role EC 3.1.1.3 (triacylglycerol lipase) inhibitor (CHEBI:65001) |
| 7-phloroeckol (CHEBI:65790) has role metabolite (CHEBI:25212) |
| 7-phloroeckol (CHEBI:65790) is a aromatic ether (CHEBI:35618) |
| 7-phloroeckol (CHEBI:65790) is a phlorotannin (CHEBI:71222) |
| IUPAC Name |
|---|
| 4-(3,5-dihydroxyphenoxy)-8-(2,4,6-trihydroxyphenoxy)oxanthrene-1,3,6-triol |
| Synonym | Source |
|---|---|
| 1-(3',5'-dihydroxyphenoxy)-7-(2'',4'',6''-trihydroxyphenoxy)-2,4,9-trihydroxydibenzo-1,4-dioxin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 7-Phloroeckol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9974456 | Reaxys |
| Citations |
|---|