EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O8 |
| Net Charge | 0 |
| Average Mass | 518.647 |
| Monoisotopic Mass | 518.28797 |
| SMILES | [H][C@]12CC[C@]34CC(=C)[C@H](CC[C@@]3([H])[C@]1(C)CCC[C@@]2(C)C(=O)O[C@H]1O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@H]1O)C4 |
| InChI | InChI=1S/C29H42O8/c1-16-13-29-12-9-21-27(4,22(29)8-7-19(16)14-29)10-6-11-28(21,5)26(33)37-25-23(32)24(35-18(3)31)20(36-25)15-34-17(2)30/h19-25,32H,1,6-15H2,2-5H3/t19?,20-,21-,22-,23+,24-,25+,27+,28+,29+/m0/s1 |
| InChIKey | NDNXVUYCJZMRRS-ABRNDMKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sagittaria pygmaea (ncbitaxon:258217) | whole plant (BTO:0001461) | PubMed (17315313) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) has functional parent β-L-arabinofuranose (CHEBI:28272) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) has role antibacterial agent (CHEBI:33282) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) has role metabolite (CHEBI:25212) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) is a ent-kaurane diterpenoid (CHEBI:36760) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose |
| Synonym | Source |
|---|---|
| 18-β-L-3',5'-diacetoxy-arabinofuranosyl-ent-kaur-16-ene | ChEBI |
| Citations |
|---|