EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O8 |
| Net Charge | 0 |
| Average Mass | 518.647 |
| Monoisotopic Mass | 518.28797 |
| SMILES | [H][C@]12CC[C@]34CC(=C)[C@H](CC[C@@]3([H])[C@]1(C)CCC[C@@]2(C)C(=O)O[C@H]1O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@H]1O)C4 |
| InChI | InChI=1S/C29H42O8/c1-16-13-29-12-9-21-27(4,22(29)8-7-19(16)14-29)10-6-11-28(21,5)26(33)37-25-23(32)24(35-18(3)31)20(36-25)15-34-17(2)30/h19-25,32H,1,6-15H2,2-5H3/t19?,20-,21-,22-,23+,24-,25+,27+,28+,29+/m0/s1 |
| InChIKey | NDNXVUYCJZMRRS-ABRNDMKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sagittaria pygmaea (ncbitaxon:258217) | whole plant (BTO:0001461) | PubMed (17315313) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) has functional parent β-L-arabinofuranose (CHEBI:28272) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) has role antibacterial agent (CHEBI:33282) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) has role metabolite (CHEBI:25212) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) is a ent-kaurane diterpenoid (CHEBI:36760) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose |
| Synonym | Source |
|---|---|
| 18-β-L-3',5'-diacetoxy-arabinofuranosyl-ent-kaur-16-ene | ChEBI |
| Citations |
|---|