EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@@H]1O[C@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a211h-1b_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4+,5-/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-KLVWXMOXSA-N |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fundamental metabolite Any metabolite produced by all living cells. fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-L-arabinofuranose (CHEBI:28272) is a L-arabinofuranose (CHEBI:6178) |
| Incoming Relation(s) |
| 3,5-di-O-acetyl-1-O-[(5β,8α,9β,10α)-18-oxokaur-16-en-18-yl]-β-L-arabinofuranose (CHEBI:65753) has functional parent β-L-arabinofuranose (CHEBI:28272) |
| IUPAC Name |
|---|
| β-L-arabinofuranose |
| UniProt Name | Source |
|---|---|
| β-L-arabinofuranose | UniProt |