EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O6 |
| Net Charge | 0 |
| Average Mass | 498.660 |
| Monoisotopic Mass | 498.29814 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)CC(CO)=C[C@]1([H])[C@]2(O)[C@H](C)C[C@@]2(OC(=O)C/C=C/C=C/CCCC)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C30H42O6/c1-6-7-8-9-10-11-12-13-24(32)36-29-16-20(3)30(35)22(25(29)27(29,4)5)15-21(18-31)17-28(34)23(30)14-19(2)26(28)33/h9-12,14-15,20,22-23,25,31,34-35H,6-8,13,16-18H2,1-5H3/b10-9+,12-11+/t20-,22+,23-,25-,28-,29+,30-/m1/s1 |
| InChIKey | AZEXNJIEBDRVJS-OSHOESKRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Excoecaria agallocha (ncbitaxon:241838) | |||
| twig (BTO:0001411) | PubMed (7623051) | ||
| leaf (BTO:0000713) | PubMed (7623051) | ||
| bark (BTO:0001301) | PubMed (7623051) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-deoxyphorbol-13-(3E,5E-decadienoate) (CHEBI:65747) has role anti-HIV agent (CHEBI:64946) |
| 12-deoxyphorbol-13-(3E,5E-decadienoate) (CHEBI:65747) has role metabolite (CHEBI:25212) |
| 12-deoxyphorbol-13-(3E,5E-decadienoate) (CHEBI:65747) is a phorbol ester (CHEBI:37532) |
| 12-deoxyphorbol-13-(3E,5E-decadienoate) (CHEBI:65747) is a primary alcohol (CHEBI:15734) |
| 12-deoxyphorbol-13-(3E,5E-decadienoate) (CHEBI:65747) is a tertiary alcohol (CHEBI:26878) |
| 12-deoxyphorbol-13-(3E,5E-decadienoate) (CHEBI:65747) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (1aR,1bS,4aR,7aS,7bR,8R,9aS)-4a,7b-dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-1,1a,1b,4,4a,5,7a,7b,8,9-decahydro-9aH-cyclopropa[3,4]benzo[1,2-e]azulen-9a-yl (3E,5E)-deca-3,5-dienoate |
| Citations |
|---|