EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H26O13 |
| Net Charge | 0 |
| Average Mass | 582.514 |
| Monoisotopic Mass | 582.13734 |
| SMILES | CC(=O)c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c(-c2c(C)cc(O)c3c2C(=O)c2cccc(O)c2C3=O)c1O |
| InChI | InChI=1S/C29H26O13/c1-9-6-13(33)21-22(23(35)11-4-3-5-12(32)19(11)26(21)38)17(9)20-14(34)7-15(18(10(2)31)25(20)37)41-29-28(40)27(39)24(36)16(8-30)42-29/h3-7,16,24,27-30,32-34,36-37,39-40H,8H2,1-2H3/t16-,24-,27+,28-,29-/m1/s1 |
| InChIKey | AOJYFODHRHWWEN-GQUXZSRASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bulbine frutescens (ncbitaxon:210954) | root (BTO:0001188) | PubMed (12193014) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) has functional parent knipholone (CHEBI:6141) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) has role antiplasmodial drug (CHEBI:64915) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) has role metabolite (CHEBI:25212) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) has role trypanocidal drug (CHEBI:36335) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) is a aromatic ketone (CHEBI:76224) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) is a dihydroxyanthraquinone (CHEBI:37484) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) is a methyl ketone (CHEBI:51867) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) is a polyphenol (CHEBI:26195) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-acetyl-4-(4,5-dihydroxy-2-methyl-9,10-dioxo-9,10-dihydroanthracen-1-yl)-3,5-dihydroxyphenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10140237 | Reaxys |
| Citations |
|---|