EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H18O8 |
| Net Charge | 0 |
| Average Mass | 434.400 |
| Monoisotopic Mass | 434.10017 |
| SMILES | COc1cc(O)c(-c2c(C)cc(O)c3c2C(=O)c2cccc(O)c2C3=O)c(O)c1C(C)=O |
| InChI | InChI=1S/C24H18O8/c1-9-7-13(27)20-21(22(29)11-5-4-6-12(26)18(11)24(20)31)16(9)19-14(28)8-15(32-3)17(10(2)25)23(19)30/h4-8,26-28,30H,1-3H3 |
| InChIKey | DUENHQWYLVQDQK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. leukotriene antagonist A drug designed to prevent leukotriene synthesis or activity by blocking binding at the receptor level. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| knipholone (CHEBI:6141) has role antineoplastic agent (CHEBI:35610) |
| knipholone (CHEBI:6141) has role antioxidant (CHEBI:22586) |
| knipholone (CHEBI:6141) has role antiplasmodial drug (CHEBI:64915) |
| knipholone (CHEBI:6141) has role leukotriene antagonist (CHEBI:49159) |
| knipholone (CHEBI:6141) has role metabolite (CHEBI:25212) |
| knipholone (CHEBI:6141) is a aromatic ketone (CHEBI:76224) |
| knipholone (CHEBI:6141) is a dihydroxyanthraquinone (CHEBI:37484) |
| knipholone (CHEBI:6141) is a methoxybenzenes (CHEBI:51683) |
| knipholone (CHEBI:6141) is a methyl ketone (CHEBI:51867) |
| knipholone (CHEBI:6141) is a polyphenol (CHEBI:26195) |
| knipholone (CHEBI:6141) is a resorcinols (CHEBI:33572) |
| Incoming Relation(s) |
| 4'-O-demethylknipholone-4'-O-β-D-glucopyranoside (CHEBI:65741) has functional parent knipholone (CHEBI:6141) |
| IUPAC Name |
|---|
| 1-(3-acetyl-2,6-dihydroxy-4-methoxyphenyl)-4,6-dihydroxy-2-methylanthracene-9,10-dione |
| Synonym | Source |
|---|---|
| Knipholone | KEGG COMPOUND |
| Citations |
|---|