EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O7 |
| Net Charge | 0 |
| Average Mass | 386.400 |
| Monoisotopic Mass | 386.13655 |
| SMILES | C/C=C/C=C/C=C/C1=CC2=CC(=O)[C@](C)(OC(=O)C[C@H](C)O)C(=O)C23OC3O1 |
| InChI | InChI=1S/C21H22O7/c1-4-5-6-7-8-9-15-11-14-12-16(23)20(3,27-17(24)10-13(2)22)18(25)21(14)19(26-15)28-21/h4-9,11-13,19,22H,10H2,1-3H3/b5-4+,7-6+,9-8+/t13-,19?,20-,21?/m0/s1 |
| InChIKey | DHOBWLDZMMCUPR-QBINLZOGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium solitum (ncbitaxon:60172) | - | PubMed (12932120) | Strain: CT2108 |
| Roles Classification |
|---|
| Biological Roles: | EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CT2108A (CHEBI:65678) has role Penicillium metabolite (CHEBI:76964) |
| CT2108A (CHEBI:65678) has role antifungal agent (CHEBI:35718) |
| CT2108A (CHEBI:65678) has role antimicrobial agent (CHEBI:33281) |
| CT2108A (CHEBI:65678) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| CT2108A (CHEBI:65678) is a azaphilone (CHEBI:50941) |
| CT2108A (CHEBI:65678) is a carboxylic ester (CHEBI:33308) |
| CT2108A (CHEBI:65678) is a enone (CHEBI:51689) |
| CT2108A (CHEBI:65678) is a epoxide (CHEBI:32955) |
| CT2108A (CHEBI:65678) is a organic heterotricyclic compound (CHEBI:26979) |
| CT2108A (CHEBI:65678) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (7S)-3-[(1E,3E,5E)-hepta-1,3,5-trien-1-yl]-7-methyl-6,8-dioxo-7,8-dihydro-6H-oxireno[j]isochromen-7-yl (3S)-3-hydroxybutanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9514663 | Reaxys |
| Citations |
|---|