EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O7 |
| Net Charge | 0 |
| Average Mass | 386.400 |
| Monoisotopic Mass | 386.13655 |
| SMILES | C/C=C/C=C/C=C/C1=CC2=CC(=O)[C@](C)(OC(=O)C[C@H](C)O)C(=O)C23OC3O1 |
| InChI | InChI=1S/C21H22O7/c1-4-5-6-7-8-9-15-11-14-12-16(23)20(3,27-17(24)10-13(2)22)18(25)21(14)19(26-15)28-21/h4-9,11-13,19,22H,10H2,1-3H3/b5-4+,7-6+,9-8+/t13-,19?,20-,21?/m0/s1 |
| InChIKey | DHOBWLDZMMCUPR-QBINLZOGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium solitum (ncbitaxon:60172) | - | PubMed (12932120) | Strain: CT2108 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CT2108A (CHEBI:65678) has role Penicillium metabolite (CHEBI:76964) |
| CT2108A (CHEBI:65678) has role antifungal agent (CHEBI:35718) |
| CT2108A (CHEBI:65678) has role antimicrobial agent (CHEBI:33281) |
| CT2108A (CHEBI:65678) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| CT2108A (CHEBI:65678) is a azaphilone (CHEBI:50941) |
| CT2108A (CHEBI:65678) is a carboxylic ester (CHEBI:33308) |
| CT2108A (CHEBI:65678) is a enone (CHEBI:51689) |
| CT2108A (CHEBI:65678) is a epoxide (CHEBI:32955) |
| CT2108A (CHEBI:65678) is a organic heterotricyclic compound (CHEBI:26979) |
| CT2108A (CHEBI:65678) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (7S)-3-[(1E,3E,5E)-hepta-1,3,5-trien-1-yl]-7-methyl-6,8-dioxo-7,8-dihydro-6H-oxireno[j]isochromen-7-yl (3S)-3-hydroxybutanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9514663 | Reaxys |
| Citations |
|---|