EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.C18H18ClN3O.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 445.903 |
| Monoisotopic Mass | 445.14045 |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1.O=C([O-])CCC(=O)[O-].[H+].[H+] |
| InChI | InChI=1S/C18H18ClN3O.C4H6O4/c1-21-8-10-22(11-9-21)18-14-12-13(19)6-7-16(14)23-17-5-3-2-4-15(17)20-18;5-3(6)1-2-4(7)8/h2-7,12H,8-11H2,1H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | YQZBAXDVDZTKEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxapine succinate (CHEBI:6549) has part loxapine (CHEBI:50841) |
| loxapine succinate (CHEBI:6549) has role geroprotector (CHEBI:176497) |
| loxapine succinate (CHEBI:6549) is a succinate salt (CHEBI:51381) |
| IUPAC Name |
|---|
| 2-chloro-11-(4-methylpiperazin-1-yl)dibenzo[b,f][1,4]oxazepine butanedioic acid |
| Synonym | Source |
|---|---|
| 2-Chloro-11-(4-methyl-1-piperazinyl)dibenz(b,f)(1,4)oxazepine succinate (1:1) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5845519 | Beilstein |
| CAS:27833-64-3 | ChemIDplus |
| Citations |
|---|