EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50841 - loxapine
| Formula | C18H18ClN3O |
| Net Charge | 0 |
| Average Mass | 327.815 |
| Monoisotopic Mass | 327.11384 |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C18H18ClN3O/c1-21-8-10-22(11-9-21)18-14-12-13(19)6-7-16(14)23-17-5-3-2-4-15(17)20-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | XJGVXQDUIWGIRW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxapine (CHEBI:50841) has role antipsychotic agent (CHEBI:35476) |
| loxapine (CHEBI:50841) has role dopaminergic antagonist (CHEBI:48561) |
| loxapine (CHEBI:50841) is a dibenzooxazepine (CHEBI:53802) |
| Incoming Relation(s) |
| loxapine succinate (CHEBI:6549) has part loxapine (CHEBI:50841) |
| IUPAC Name |
|---|
| 2-chloro-11-(4-methylpiperazin-1-yl)dibenzo[b,f][1,4]oxazepine |
| INNs | Source |
|---|---|
| loxapine | ChemIDplus |
| loxapinum | ChemIDplus |
| loxapina | ChemIDplus |
| Synonyms | Source |
|---|---|
| Loxapine | KEGG COMPOUND |
| 2-chloro-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine | NIST Chemistry WebBook |
| oxilapine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Cloxazepine | DrugBank |