EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClN3O |
| Net Charge | 0 |
| Average Mass | 327.815 |
| Monoisotopic Mass | 327.11384 |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C18H18ClN3O/c1-21-8-10-22(11-9-21)18-14-12-13(19)6-7-16(14)23-17-5-3-2-4-15(17)20-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | XJGVXQDUIWGIRW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxapine (CHEBI:50841) has role antipsychotic agent (CHEBI:35476) |
| loxapine (CHEBI:50841) has role dopaminergic antagonist (CHEBI:48561) |
| loxapine (CHEBI:50841) is a dibenzooxazepine (CHEBI:53802) |
| Incoming Relation(s) |
| loxapine succinate (CHEBI:6549) has part loxapine (CHEBI:50841) |
| IUPAC Name |
|---|
| 2-chloro-11-(4-methylpiperazin-1-yl)dibenzo[b,f][1,4]oxazepine |
| INNs | Source |
|---|---|
| loxapina | ChemIDplus |
| loxapine | ChemIDplus |
| loxapinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-chloro-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine | NIST Chemistry WebBook |
| Loxapine | KEGG COMPOUND |
| oxilapine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Cloxazepine | DrugBank |