EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50841 - loxapine
| Formula | C18H18ClN3O |
| Net Charge | 0 |
| Average Mass | 327.815 |
| Monoisotopic Mass | 327.11384 |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C18H18ClN3O/c1-21-8-10-22(11-9-21)18-14-12-13(19)6-7-16(14)23-17-5-3-2-4-15(17)20-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | XJGVXQDUIWGIRW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loxapine (CHEBI:50841) has role anti-asthmatic agent (CHEBI:65023) |
| loxapine (CHEBI:50841) has role antipsychotic agent (CHEBI:35476) |
| loxapine (CHEBI:50841) has role anxiolytic drug (CHEBI:35474) |
| loxapine (CHEBI:50841) has role dopaminergic antagonist (CHEBI:48561) |
| loxapine (CHEBI:50841) is a dibenzooxazepine (CHEBI:53802) |
| Incoming Relation(s) |
| loxapine succinate (CHEBI:6549) has part loxapine (CHEBI:50841) |
| IUPAC Name |
|---|
| 2-chloro-11-(4-methylpiperazin-1-yl)dibenzo[b,f][1,4]oxazepine |
| INNs | Source |
|---|---|
| loxapina | ChemIDplus |
| loxapine | ChemIDplus |
| loxapinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-chloro-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine | NIST Chemistry WebBook |
| CL 62,362 | ChEMBL |
| CL-62362 | ChEMBL |
| Loxapine | KEGG COMPOUND |
| oxilapine | ChemIDplus |
| SUM 3170 | ChEMBL |
| Brand Name | Source |
|---|---|
| Cloxazepine | DrugBank |
| Citations |
|---|