EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O3 |
| Net Charge | 0 |
| Average Mass | 458.727 |
| Monoisotopic Mass | 458.37600 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C(C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h18-24,31H,8-17H2,1-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
| InChIKey | PZXJOHSZQAEJFE-FZFNOLFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Syzygium claviflorum (ncbitaxon:219860) | leaf (BTO:0000713) | PubMed (8176401) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrobetulinic acid (CHEBI:65485) has parent hydride lupane (CHEBI:36485) |
| dihydrobetulinic acid (CHEBI:65485) has role anti-HIV agent (CHEBI:64946) |
| dihydrobetulinic acid (CHEBI:65485) has role antileishmanial agent (CHEBI:70868) |
| dihydrobetulinic acid (CHEBI:65485) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| dihydrobetulinic acid (CHEBI:65485) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| dihydrobetulinic acid (CHEBI:65485) has role metabolite (CHEBI:25212) |
| dihydrobetulinic acid (CHEBI:65485) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| dihydrobetulinic acid (CHEBI:65485) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3β)-3-hydroxylupan-28-oic acid |
| Synonym | Source |
|---|---|
| 20,29-dihydrobetulinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US5679828 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2678211 | Reaxys |
| CAS:25488-53-3 | ChemIDplus |
| Citations |
|---|