EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56O6 |
| Net Charge | 0 |
| Average Mass | 584.838 |
| Monoisotopic Mass | 584.40769 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(=O)CC(C)(C)C(=O)O)CC[C@]21C |
| InChI | InChI=1S/C36H56O6/c1-21(2)22-12-17-36(30(40)41)19-18-34(8)23(28(22)36)10-11-25-33(7)15-14-26(42-27(37)20-31(3,4)29(38)39)32(5,6)24(33)13-16-35(25,34)9/h22-26,28H,1,10-20H2,2-9H3,(H,38,39)(H,40,41)/t22-,23+,24-,25+,26-,28+,33-,34+,35+,36-/m0/s1 |
| InChIKey | YJEJKUQEXFSVCJ-WRFMNRASSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Syzygium claviflorum (ncbitaxon:219860) | leaf (BTO:0000713) | PubMed (8176401) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | HIV-1 maturation inhibitor A compound that blocks the processing of the Gag precursor protein in HIV-1 by the viral protease enzyme, leading to the formation of noninfectious, immature virus particles that are incapable of infecting other cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bevirimat (CHEBI:65484) has functional parent betulinic acid (CHEBI:3087) |
| bevirimat (CHEBI:65484) has role HIV-1 maturation inhibitor (CHEBI:71168) |
| bevirimat (CHEBI:65484) has role metabolite (CHEBI:25212) |
| bevirimat (CHEBI:65484) is a dicarboxylic acid monoester (CHEBI:36244) |
| bevirimat (CHEBI:65484) is a monocarboxylic acid (CHEBI:25384) |
| bevirimat (CHEBI:65484) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3β)-3-[(3-carboxy-3-methylbutanoyl)oxy]lup-20(29)-en-28-oic acid |
| INNs | Source |
|---|---|
| bevirimat | ChemIDplus |
| bevirimat | WHO MedNet |
| bévirimat | WHO MedNet |
| bevirimatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-O-(3',3'-dimethylsuccinyl) betulinic acid | ChEBI |
| BVM | ChEBI |
| PA-457 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bevirimat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7504927 | Reaxys |
| CAS:174022-42-5 | ChemIDplus |
| Citations |
|---|