EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56O6 |
| Net Charge | 0 |
| Average Mass | 584.838 |
| Monoisotopic Mass | 584.40769 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(=O)CC(C)(C)C(=O)O)CC[C@]21C |
| InChI | InChI=1S/C36H56O6/c1-21(2)22-12-17-36(30(40)41)19-18-34(8)23(28(22)36)10-11-25-33(7)15-14-26(42-27(37)20-31(3,4)29(38)39)32(5,6)24(33)13-16-35(25,34)9/h22-26,28H,1,10-20H2,2-9H3,(H,38,39)(H,40,41)/t22-,23+,24-,25+,26-,28+,33-,34+,35+,36-/m0/s1 |
| InChIKey | YJEJKUQEXFSVCJ-WRFMNRASSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Syzygium claviflorum (ncbitaxon:219860) | leaf (BTO:0000713) | PubMed (8176401) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 maturation inhibitor A compound that blocks the processing of the Gag precursor protein in HIV-1 by the viral protease enzyme, leading to the formation of noninfectious, immature virus particles that are incapable of infecting other cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bevirimat (CHEBI:65484) has functional parent betulinic acid (CHEBI:3087) |
| bevirimat (CHEBI:65484) has role HIV-1 maturation inhibitor (CHEBI:71168) |
| bevirimat (CHEBI:65484) has role metabolite (CHEBI:25212) |
| bevirimat (CHEBI:65484) is a dicarboxylic acid monoester (CHEBI:36244) |
| bevirimat (CHEBI:65484) is a monocarboxylic acid (CHEBI:25384) |
| bevirimat (CHEBI:65484) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3β)-3-[(3-carboxy-3-methylbutanoyl)oxy]lup-20(29)-en-28-oic acid |
| INNs | Source |
|---|---|
| bevirimat | ChemIDplus |
| bevirimat | WHO MedNet |
| bevirimatum | WHO MedNet |
| bévirimat | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-O-(3',3'-dimethylsuccinyl) betulinic acid | ChEBI |
| PA-457 | ChEBI |
| BVM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Bevirimat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7504927 | Reaxys |
| CAS:174022-42-5 | ChemIDplus |
| Citations |
|---|