EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H34N2O4 |
| Net Charge | 0 |
| Average Mass | 570.689 |
| Monoisotopic Mass | 570.25186 |
| SMILES | CC(C)=CCC/C(C)=C/CN1c2cc(C(=O)c3ccccc3)ccc2Nc2c(C(=O)O)cc(C(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C37H34N2O4/c1-24(2)11-10-12-25(3)19-20-39-32-22-28(35(40)26-13-6-4-7-14-26)17-18-31(32)38-34-30(37(42)43)21-29(23-33(34)39)36(41)27-15-8-5-9-16-27/h4-9,11,13-19,21-23,38H,10,12,20H2,1-3H3,(H,42,43)/b25-19+ |
| InChIKey | ZXEFSITWOFAFSF-NCELDCMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces prunicolor (ncbitaxon:67348) | mycelium (BTO:0001436) | DOI (10.1021/np50098a008) | Strain: 1884 SVT2 |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benthophoenin (CHEBI:65482) has role metabolite (CHEBI:25212) |
| benthophoenin (CHEBI:65482) has role radical scavenger (CHEBI:48578) |
| benthophoenin (CHEBI:65482) is a aromatic ketone (CHEBI:76224) |
| benthophoenin (CHEBI:65482) is a diketone (CHEBI:46640) |
| benthophoenin (CHEBI:65482) is a dioxo monocarboxylic acid (CHEBI:35951) |
| benthophoenin (CHEBI:65482) is a phenazines (CHEBI:39201) |
| IUPAC Name |
|---|
| 3,7-dibenzoyl-5-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-5,10-dihydrophenazine-1-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22344588 | Reaxys |