EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O11 |
| Net Charge | 0 |
| Average Mass | 440.401 |
| Monoisotopic Mass | 440.13186 |
| SMILES | COc1cc(O)c2c(=O)c3c(oc2c1)[C@H](O)CC[C@@H]3O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H24O11/c1-28-7-4-9(23)13-11(5-7)29-19-8(22)2-3-10(14(19)16(13)25)30-20-18(27)17(26)15(24)12(6-21)31-20/h4-5,8,10,12,15,17-18,20-24,26-27H,2-3,6H2,1H3/t8-,10+,12-,15-,17+,18-,20-/m1/s1 |
| InChIKey | FOVMRYXSQHNGSU-GSCMKZIOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia japonica (ncbitaxon:137129) | - | PubMed (10353265) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydroswertianolin (CHEBI:65479) has functional parent swertianolin (CHEBI:65478) |
| tetrahydroswertianolin (CHEBI:65479) has role hepatoprotective agent (CHEBI:62868) |
| tetrahydroswertianolin (CHEBI:65479) has role plant metabolite (CHEBI:76924) |
| tetrahydroswertianolin (CHEBI:65479) is a aromatic ether (CHEBI:35618) |
| tetrahydroswertianolin (CHEBI:65479) is a monosaccharide derivative (CHEBI:63367) |
| tetrahydroswertianolin (CHEBI:65479) is a xanthone glycoside (CHEBI:83231) |
| tetrahydroswertianolin (CHEBI:65479) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (1S,4R)-4,8-dihydroxy-6-methoxy-9-oxo-2,3,4,9-tetrahydro-1H-xanthen-1-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7731015 | Reaxys |
| Citations |
|---|