EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O6 |
| Net Charge | 0 |
| Average Mass | 312.277 |
| Monoisotopic Mass | 312.06339 |
| SMILES | O=C1OC(c2ccc(O)c(O)c2)=C/C1=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H12O6/c18-12-3-1-9(6-14(12)20)5-11-8-16(23-17(11)22)10-2-4-13(19)15(21)7-10/h1-8,18-21H/b11-5+ |
| InChIKey | TZBZGNPXKXHFKI-VZUCSPMQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhizoctonia solani (ncbitaxon:456999) | - | PubMed (8175480) | Strain: F23372 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BE-23372M (CHEBI:65473) has role antimicrobial agent (CHEBI:33281) |
| BE-23372M (CHEBI:65473) has role metabolite (CHEBI:25212) |
| BE-23372M (CHEBI:65473) has role tyrosine kinase inhibitor (CHEBI:38637) |
| BE-23372M (CHEBI:65473) is a butenolide (CHEBI:50523) |
| BE-23372M (CHEBI:65473) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (3E)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)furan-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6849861 | Reaxys |
| CAS:145588-13-2 | ChemIDplus |
| Citations |
|---|