EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O6 |
| Net Charge | 0 |
| Average Mass | 312.277 |
| Monoisotopic Mass | 312.06339 |
| SMILES | O=C1OC(c2ccc(O)c(O)c2)=C/C1=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H12O6/c18-12-3-1-9(6-14(12)20)5-11-8-16(23-17(11)22)10-2-4-13(19)15(21)7-10/h1-8,18-21H/b11-5+ |
| InChIKey | TZBZGNPXKXHFKI-VZUCSPMQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhizoctonia solani (ncbitaxon:456999) | - | PubMed (8175480) | Strain: F23372 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BE-23372M (CHEBI:65473) has role antimicrobial agent (CHEBI:33281) |
| BE-23372M (CHEBI:65473) has role metabolite (CHEBI:25212) |
| BE-23372M (CHEBI:65473) has role tyrosine kinase inhibitor (CHEBI:38637) |
| BE-23372M (CHEBI:65473) is a butenolide (CHEBI:50523) |
| BE-23372M (CHEBI:65473) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (3E)-3-(3,4-dihydroxybenzylidene)-5-(3,4-dihydroxyphenyl)furan-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6849861 | Reaxys |
| CAS:145588-13-2 | ChemIDplus |
| Citations |
|---|